
CAS Number128-13-2
Synonyms(3a,5b,7b,8x)-3,7-dihydroxycholan-24-oic acid; Ursofalk; 17b-(1-Methyl-3-carboxypropyl)etiocholane-3a,7b-diol; 3α,7β-Dihydroxy-6β-cholan-24-oic acid; Ursolvan; Ursochol; Peptarom; Actigall; Delursan; Ursodeoxycholic acid; (3α,5β,7β)-3,7-Dihydroxycholan-24-oic acid; 3a,7b-dihydroxy-5b-cholan-24-oic acid; (3α,5β,7β,8ξ,20R)-3,7-Dihydroxycholan-24-oic acid; Litursol; Cholit-ursan; (3a,5b,7b)-3,7-dihydroxy-cholan-24-oic acid; 3,7-Dihydroxycholan-24-oic acid; 3α,7β-dihydroxy-5β-cholan-24-oic acid; (3a,5b,7b)-3,7-Dihydroxycholan-24-oic Acid; Ursacol; Ursodiol; 3a,7b-Dioxycholanic Acid; Destolit; MFCD00003680; 3alpha,7beta-Dihydroxy-6beta-cholan-24-oic acid; Arsacol; EINECS 204-879-3
Molecular FormulaC24H40O4
Molecular Weight392.57
Purity≥99%
Density1.1±0.1 g/cm3
Boiling Point547.1±25.0 °C at 760 mmHg
Melting Point203-204 °C (lit.)
Appearancepowder
EINECS204-879-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 128-13-2 |
| Catalog No. | 2A-9012893 |
| Chinese Name | 熊去氧胆酸 |
| Synonyms | (3a,5b,7b,8x)-3,7-dihydroxycholan-24-oic acid; Ursofalk; 17b-(1-Methyl-3-carboxypropyl)etiocholane-3a,7b-diol; 3α,7β-Dihydroxy-6β-cholan-24-oic acid; Ursolvan; Ursochol; Peptarom; Actigall; Delursan; Ursodeoxycholic acid; (3α,5β,7β)-3,7-Dihydroxycholan-24-oic acid; 3a,7b-dihydroxy-5b-cholan-24-oic acid; (3α,5β,7β,8ξ,20R)-3,7-Dihydroxycholan-24-oic acid; Litursol; Cholit-ursan; (3a,5b,7b)-3,7-dihydroxy-cholan-24-oic acid; 3,7-Dihydroxycholan-24-oic acid; 3α,7β-dihydroxy-5β-cholan-24-oic acid; (3a,5b,7b)-3,7-Dihydroxycholan-24-oic Acid; Ursacol; Ursodiol; 3a,7b-Dioxycholanic Acid; Destolit; MFCD00003680; 3alpha,7beta-Dihydroxy-6beta-cholan-24-oic acid; Arsacol; EINECS 204-879-3 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.57 |
| Purity | ≥99 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 547.1±25.0 °C at 760 mmHg |
| Melting Point | 203-204 °C (lit.) |
| Appearance | powder |
| Water Solubility | Insoluble |
| Storage Condition | Storage: Shade from light and keep in airtight con |
| Application | Ursodiol can reduce cholesterol absorption and can help dissolve gallstones. |
| EINECS | 204-879-3 |
| PubChem ID | 24900651 |
| MDL Number | MFCD00003680 |
| SMILES | C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | 1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 |
| InChI Key | RUDATBOHQWOJDD-UZVSRGJWSA-N |
| Beilstein/REAXYS | 3219888 |
| NACRES Code | NA.25 |
| UNSPSC | 12161900 |
| MSDS | msds/12893_1_128_13_2.pdf |
| Transport Info | Product name: Ursodeoxycholic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Uncaria | 2A-303969 | 2A-9012885 |
| Underleaf pearl extract | 2A-303970 | 2A-9012886 |
| Upenazime | 95268-62-5 | 2A-9012889 |
| Urefibrate | 38647-79-9 | 2A-9012891 |
| Urokinase | 9039-53-6 | 2A-9012892 |
| Usnic acid | 125-46-2 | 2A-9012895 |
| Utibapril | 109683-61-6 | 2A-9012896 |
| Utibaprilat | 109683-79-6 | 2A-9012897 |
| Valdecoxib | 181695-72-7 | 2A-9012900 |
| Valeramide | 626-97-1 | 2A-9012901 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA