
CAS Number15360-02-8
Synonyms3-T-BUTOXYBENZOIC ACID; m-t-Butoxybenzoesaeure; Benzoic acid,m-tert-butoxy; m-t-butoxybenzoic acid; m-tert.-Butoxybenzoesaeure; tertbutoxybenzenecarboxylicacid; Benzoic acid,3-(1,1-dimethylethoxy); 3-tert-butoxy-benzoic acid; 3-(tert-butoxy)benzenecarboxylic acid
Molecular FormulaC11H14O3
Molecular Weight194.23
Purity96+%
Density1.106±0.06 g/ml
Appearancewhite solid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15360-02-8 |
| Catalog No. | 2A-0128445 |
| Chinese Name | 3-叔丁氧基苯甲酸 |
| Synonyms | 3-T-BUTOXYBENZOIC ACID; m-t-Butoxybenzoesaeure; Benzoic acid,m-tert-butoxy; m-t-butoxybenzoic acid; m-tert.-Butoxybenzoesaeure; tertbutoxybenzenecarboxylicacid; Benzoic acid,3-(1,1-dimethylethoxy); 3-tert-butoxy-benzoic acid; 3-(tert-butoxy)benzenecarboxylic acid |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 |
| Purity | 96+ |
| Density | 1.106±0.06 g/ml |
| Appearance | white solid |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 8688913 |
| MDL Number | MFCD03412397 |
| SMILES | CC(C)(C)Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C11H14O3/c1-11(2,3)14-9-6-4-5-8(7-9)10(12)13/h4-7H,1-3H3,(H,12,13) |
| InChI Key | IURSJORDCNZJFE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(PYRROLIDIN-1-YL)PROPAN-1-OL | 19748-66-4 | 2A-0128419 |
| 3-(PYRROLIDIN-1-YLSULFONYL)ANILINE | 91619-38-4 | 2A-0128422 |
| 3-(PYRROLIDIN-1-YLSULFONYL)BENZOIC ACID | 7326-79-6 | 2A-0128423 |
| 3-(PYRROLIDIN-1-YLSULFONYL)BENZONITRILE | 1003740-90-6 | 2A-0128424 |
| 3-(STYRYLSULFONYL)PROPANOIC ACID | 175205-22-8 | 2A-0128442 |
| 3-(TERT-BUTYL)-1-(4-METHOXYPHENYL)-1H-PYRAZOL-5-AMINE | 227623-26-9 | 2A-0128454 |
| 3-(TERT-BUTYL)-1-(PYRIDIN-4-YL)-1H-PYRAZOL-5-AMINE | 884340-12-9 | 2A-0128457 |
| 3-(TERT-BUTYL)-1-ISOPROPYL-1H-PYRAZOL-5-AMINE | 874136-23-9 | 2A-0128458 |
| 3-(TERT-BUTYL)-4-HYDROXYBENZONITRILE | 4910-04-7 | 2A-0128465 |
| 3-(TERT-BUTYL)-4-METHOXYPHENOL | 88-32-4 | 2A-1128468 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA