
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81266-47-9 |
| Catalog No. | 2A-0128285 |
| Chinese Name | 3-(硝甲基)环戊酮 |
| Synonyms | 3-(Nitromethyl)cyclopentanone; 3-(nitromethyl)cyclopentan-1-one |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.141 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 279.8±13.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 17406193 |
| SMILES | O=C1CCC(C[N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H9NO3/c8-6-2-1-5(3-6)4-7(9)10/h5H,1-4H2 |
| InChI Key | OXUCMXDWKATUHP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(NAPHTHALEN-1-YL)PROPIOLIC ACID | 4843-42-9 | 2A-0128278 |
| 3-(NAPHTHALEN-1-YLMETHYLENE)INDOLIN-2-ONE | 55160-03-7 | 2A-0128279 |
| 3-(NAPHTHALEN-1-YLOXY)BENZONITRILE | 1314406-41-1 | 2A-0128281 |
| 3-(NAPHTHALEN-1-YLOXY)PROPAN-1-AMINE | 58477-93-3 | 2A-0128282 |
| 3-(NAPHTHALEN-2-YL)PROPAN-1-AMINE | 13198-21-5 | 2A-0128283 |
| 3-(O-TOLYL)PYRROLIDIN-3-OL | 702630-29-3 | 2A-0128287 |
| 3-(OXIRAN-2-YLMETHOXY)BENZOIC ACID | 185522-04-7 | 2A-0128293 |
| 3-(PHENETHYL(PHENYL)AMINO)PROPANENITRILE | 17601-74-0 | 2A-0128312 |
| 3-(PHENYLSULFONAMIDO)PROPANOIC ACID | 31867-78-4 | 2A-0128318 |
| 3-(PIPERAZIN-1-YL)PROPANOIC ACID | 27245-31-4 | 2A-0128329 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA