
CAS Number167300-06-3
Synonyms3-(Methoxycarbonyl)-4-methylbenzoic acid; 4-Methyl-3-(methoxycarbonyl)benzoic acid; 4-methyl-3-[(methyloxy)carbonyl]benzoic acid; 1,3-Benzenedicarboxylic acid, 4-methyl-, 3-methyl ester; 4-methyl-isophthalic acid 3-methyl ester; Methyl-2-methyl-5-carboxylicbenzoic acid
Molecular FormulaC10H10O4
Molecular Weight194.19
Purity96+%
Density1.2±0.1 g/cm3
Boiling Point349.9±30.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 167300-06-3 |
| Catalog No. | 2A-0128191 |
| Chinese Name | 3-(甲氧基羰基)-4-甲基苯甲酸 |
| Synonyms | 3-(Methoxycarbonyl)-4-methylbenzoic acid; 4-Methyl-3-(methoxycarbonyl)benzoic acid; 4-methyl-3-[(methyloxy)carbonyl]benzoic acid; 1,3-Benzenedicarboxylic acid, 4-methyl-, 3-methyl ester; 4-methyl-isophthalic acid 3-methyl ester; Methyl-2-methyl-5-carboxylicbenzoic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 349.9±30.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 55550356 |
| SMILES | COC(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C10H10O4/c1-6-3-4-7(9(11)12)5-8(6)10(13)14-2/h3-5H,1-2H3,(H,11,12) |
| InChI Key | FLYZXCACBSFFHE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(HYDROXYMETHYL)PICOLINONITRILE | 131747-56-3 | 2A-0128158 |
| 3-(HYDROXYMETHYL)PIPERIDIN-4-OL | 252906-75-5 | 2A-1128159 |
| 3-(HYDROXYPHENYLMETHYL)PHENOL | 7765-98-2 | 2A-0128162 |
| 3-(ISOINDOLIN-2-YL)ANILINE | 1160263-98-8 | 2A-0128171 |
| 3-(ISOPROPYLAMINO)PROPAN-1-OL | 33918-15-9 | 2A-0128176 |
| 3-(METHOXYMETHYL)BENZOIC ACID | 32194-76-6 | 2A-1128201 |
| 3-(METHYLAMINO)PHENOL | 14703-69-6 | 2A-0128204 |
| 3-(METHYLSULFONYL)-[1,1'-BIPHENYL]-4-AMINE | 16734-99-9 | 2A-0128214 |
| 3-(METHYLSULFONYL)-5-MORPHOLINOANILINE | 945397-18-2 | 2A-0128216 |
| 3-(METHYLSULFONYL)-5-NITROBENZOIC ACID | 58123-66-3 | 2A-0128217 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA