
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30910-27-1 |
| Catalog No. | 2A-9012801 |
| Chinese Name | 曲洛酯 |
| Synonyms | Treloxinato; UNII-7YA71JCD50; Treloxinatum; TRELOXINATE |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17000 |
| Purity | 98.00 |
| Density | 1.383g/cm3 |
| Boiling Point | 498.3ºC at 760mmHg |
| HTC | 2918300090 |
| SMILES | COC(=O)C1Oc2ccc(Cl)cc2Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C16H12Cl2O4/c1-20-15(19)16-21-13-4-2-11(17)7-9(13)6-10-8-12(18)3-5-14(10)22-16/h2-5,7-8,16H,6H2,1H3 |
| InChI Key | BORQIQWYKSNHKN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Transcainide | 88296-62-2 | 2A-9012796 |
| Trans-sobrerol | 42370-41-2 | 2A-9012797 |
| Trapidil | 15421-84-8 | 2A-9012798 |
| Trecovirsen | 148998-94-1 | 2A-9012799 |
| Trelnarizine | 123205-52-7 | 2A-9012800 |
| Trenbolone | 10161-33-8 | 2A-9012802 |
| Trental | 1677-68-7 | 2A-9012803 |
| Trepirium iodide | 1018-34-7 | 2A-9012804 |
| Treptilamine | 58313-74-9 | 2A-9012805 |
| Trequinsin | 78416-81-6 | 2A-9012806 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA