
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 143612-79-7 |
| Catalog No. | 2A-1127477 |
| Chinese Name | 3-(4-氯丁基)吲哚-5-甲腈 |
| Synonyms | 3-(4-Chlorobutyl)-1H-indole-5-carbonitrile |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 232.71 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 448.1±35.0 °C at 760 mmHg |
| Melting Point | 99-100℃ |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: dimethylformamide |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2933990090 |
| UN(IATA) | 0 |
| PubChem ID | 14847256 |
| SMILES | N#Cc1ccc2[nH]cc(CCCCCl)c2c1 |
| InChI | InChI=1S/C13H13ClN2/c14-6-2-1-3-11-9-16-13-5-4-10(8-15)7-12(11)13/h4-5,7,9,16H,1-3,6H2 |
| InChI Key | NJJWMEJWFYRORL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-(4-BROMOPHENYL)-5-ISOPROPYL-1,2,4-OXADIAZOLE | 917562-24-4 | 2A-0127422 |
| 3-(4-BROMOPHENYL)-5-PHENYL-1,2,4-OXADIAZOLE | 65004-19-5 | 2A-0127425 |
| 3-(4-BROMOPHENYL)-5-PROPYL-1,2,4-OXADIAZOLE | 312750-72-4 | 2A-0127426 |
| 3-(4-BROMOPHENYL)ISOXAZOLE | 13484-04-3 | 2A-0127434 |
| 3-(4-BROMOPHENYL)PYRROLIDINE | 328546-98-1 | 2A-0127441 |
| 3-(4-CHLOROPHENOXY)PIPERIDINE | 384346-27-4 | 2A-0127479 |
| 3-(4-CHLOROPHENYL)-1,2,4-OXADIAZOLE | 10550-15-9 | 2A-0127481 |
| 3-(4-CHLOROPHENYL)-1H-PYRAZOLE-4-CARBOXYLIC ACID | 135641-91-7 | 2A-1127489 |
| 3-(4-CHLOROPHENYL)-4,5,6,7-TETRAHYDRO-1H-PYRAZOLO[4,3-C]PYRIDINE HYDROCHLORIDE | 87628-52-2 | 2A-0127497 |
| 3-(4-CHLOROPHENYL)-5-(TRIFLUOROMETHYL)-1H-PYRAZOLE | 142623-90-3 | 2A-0127501 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA