
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1424-74-4 |
| Catalog No. | 2A-0127163 |
| Chinese Name | 3-(3-羟丙基)-苯酚 |
| Synonyms | 3-(3-hydroxypropyl)phenol |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19000 |
| Purity | 96+ |
| Density | 1.13g/cm3 |
| Boiling Point | 313.566ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2907299090 |
| UN(IATA) | 0 |
| PubChem ID | 15363755 |
| SMILES | OCCCc1cccc(O)c1 |
| InChI | InChI=1S/C9H12O2/c10-6-2-4-8-3-1-5-9(11)7-8/h1,3,5,7,10-11H,2,4,6H2 |
| InChI Key | TVQDIGAZKJXXLX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-CHLOROPHENYL)-2-MERCAPTOQUINAZOLIN-4(3H)-ONE | 1028-38-2 | 2A-0127118 |
| 3-(3-CHLOROPHENYL)PROPAN-1-OL | 22991-03-3 | 2A-0127125 |
| 3-(3-FLUOROPHENYL)PROPANAL | 245070-85-3 | 2A-0127152 |
| 3-(3-HYDROXY-3-METHYLBUT-1-YN-1-YL)PHENOL | 90684-07-4 | 2A-0127155 |
| 3-(3-HYDROXYPROP-1-YN-1-YL)BENZONITRILE | 170859-72-0 | 2A-0127162 |
| 3-(3-METHOXYPHENYL)PROPANAL | 40138-66-7 | 2A-2127180 |
| 3-(3-METHOXYPROPOXY)ANILINE | 1023277-27-1 | 2A-0127184 |
| 3-(3-METHYL-5-OXO-4,5-DIHYDRO-1H-PYRAZOL-4-YL)PROPANOIC ACID | 224568-17-6 | 2A-0127193 |
| 3-(3-NITROPHENYL)-3-OXOPROPANENITRILE | 21667-64-1 | 2A-0127206 |
| 3-(3-NITROPHENYL)PROPIOLIC ACID | 4996-15-0 | 2A-0127210 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA