
CAS Number168833-77-0
SynonymsQV2R COXFFF; MFCD01317834; 3-(3-(Trifluoromethoxy)phenyl)propanoic acid; 3-[3-(Trifluoromethoxy)phenyl]propionic acid; m-trifluoromethoxyhydrocinnamic acid; 3-(Trifluoromethoxy)benzenepropanoic acid; 3-(Trifluoromethoxy)hydrocinnamic acid; 3-[3-(Trifluoromethoxy)phenyl]propanoic acid
Molecular FormulaC10H9F3O3
Molecular Weight234.17
Purity96+%
Density1.3±0.1 g/cm3
Boiling Point276.9±35.0 °C at 760 mmHg
Melting Point-32°C
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 168833-77-0 |
| Catalog No. | 2A-0127068 |
| Chinese Name | 3-(三氟甲氧基)-苯丙酸 |
| Synonyms | QV2R COXFFF; MFCD01317834; 3-(3-(Trifluoromethoxy)phenyl)propanoic acid; 3-[3-(Trifluoromethoxy)phenyl]propionic acid; m-trifluoromethoxyhydrocinnamic acid; 3-(Trifluoromethoxy)benzenepropanoic acid; 3-(Trifluoromethoxy)hydrocinnamic acid; 3-[3-(Trifluoromethoxy)phenyl]propanoic acid |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 276.9±35.0 °C at 760 mmHg |
| Melting Point | -32°C |
| Water Solubility | slightly soluble |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 3213904 |
| SMILES | O=C(O)CCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3O3/c11-10(12,13)16-8-3-1-2-7(6-8)4-5-9(14)15/h1-3,6H,4-5H2,(H,14,15) |
| InChI Key | WGEVFUNNEITJFQ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)PROPANOIC ACID | 72145-01-8 | 2A-0127039 |
| 3-(3-(4-(2-METHOXYETHOXY)PHENYL)-1,2,4-OXADIAZOL-5-YL)BENZOIC ACID | 745055-24-7 | 2A-0127048 |
| 3-(3-(DIMETHYLAMINO)PROPOXY)ANILINE | 1135-26-8 | 2A-0127058 |
| 3-(3-(HYDROXYMETHYL)PHENYL)ISONICOTINIC ACID | 1261991-78-9 | 2A-0127059 |
| 3-(3-(M-TOLYL)UREIDO)PROPANOIC ACID | 133115-50-1 | 2A-0127060 |
| 3-(3-AMINO-1H-PYRAZOL-1-YL)PROPAN-1-OL | 1003011-38-8 | 2A-0127078 |
| 3-(3-AMINO-1H-PYRAZOL-1-YL)PROPANENITRILE | 58876-75-8 | 2A-0127079 |
| 3-(3-AMINOPHENYL)-1H-PYRAZOL-5(4H)-ONE HYDROCHLORIDE | 1185508-90-0 | 2A-0127081 |
| 3-(3-BORONOPHENYL)PROPANOIC ACID | 693803-17-7 | 2A-0127087 |
| 3-(3-BROMO-2-FLUOROPHENYL)ACRYLIC ACID | 1214791-57-7 | 2A-0127088 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA