
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13398-94-2 |
| Catalog No. | 2A-1126876 |
| Chinese Name | 2-(3-羟基苯基)乙醇 |
| Synonyms | 3-(2-Hydroxyethyl)phenol; 3-Hydroxyphenethyl alcohol; MFCD00002895; EINECS 236-485-2; m-Hydroxyphenethyl alcohol |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.164 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 332.9±0.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| EINECS | 0 |
| HTC | 2907299090 |
| UN(IATA) | 0 |
| PubChem ID | 404651 |
| SMILES | OCCc1cccc(O)c1 |
| InChI | InChI=1S/C8H10O2/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,9-10H,4-5H2 |
| InChI Key | InChIKey=AMQIPHZFLIDOCB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-ETHOXYETHOXY)BENZONITRILE | 1095085-73-6 | 2A-0126832 |
| 3-(2-ETHYLPIPERIDIN-1-YL)PROPANOIC ACID | 933719-77-8 | 2A-0126845 |
| 3-(2-FLUOROPHENOXY)-7-HYDROXY-4H-CHROMEN-4-ONE | 137374-74-4 | 2A-0126853 |
| 3-(2-FLUOROPHENYL)-N-(4-(PYRIDIN-4-YLMETHYL)PHENYL)PROPANAMIDE | 1377951-04-6 | 2A-0126860 |
| 3-(2-FORMYL-4-METHYL-1H-PYRROL-3-YL)PROPANOIC ACID | 132281-87-9 | 2A-0126870 |
| 3-(2-HYDROXYETHYL)PIPERAZIN-2-ONE | 936940-62-4 | 2A-0126877 |
| 3-(2-HYDROXYNAPHTHALEN-1-YL)PROPANENITRILE | 14233-73-9 | 2A-0126880 |
| 3-(2-METHOXYETHOXY)BENZOIC ACID | 152808-60-1 | 2A-0126898 |
| 3-(2-METHOXYETHOXY)BENZONITRILE | 80407-67-6 | 2A-0126899 |
| 3-(2-METHOXYPHENOXY)PROPAN-1-AMINE HYDROCHLORIDE | 1366407-75-1 | 2A-0126907 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA