
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175136-81-9 |
| Catalog No. | 2A-0126420 |
| Chinese Name | 3-(2,6-二氯苄基)-2,4-戊二酮 |
| Synonyms | Exact Mass 258.02100; PSA 34.14000; LogP 3.33010; InChIKey JJHUBEFIMHFCRR-UHFFFAOYSA-N |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.12800 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 3262928 |
| SMILES | CC(=O)C(Cc1c(Cl)cccc1Cl)C(C)=O |
| InChI | InChI=1S/C12H12Cl2O2/c1-7(15)9(8(2)16)6-10-11(13)4-3-5-12(10)14/h3-5,9H,6H2,1-2H3 |
| InChI Key | JJHUBEFIMHFCRR-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-(2,4-DIFLUOROPHENYL)PROPANENITRILE | 134672-74-5 | 2A-0126396 |
| 3-(2,4-DIFLUOROPHENYL)PROPIONIC ACID | 134672-70-1 | 2A-0126397 |
| 3-(2,4-DIHYDROXYBENZYLIDENE)INDOLIN-2-ONE | 328106-29-2 | 2A-0126398 |
| 3-(2,4-DIMETHYL-6-OXO-1,6-DIHYDROPYRIDIN-3-YL)PROPANOIC ACID | 1119453-13-2 | 2A-0126400 |
| 3-(2,4-DINITROPHENYL)PROPANOIC ACID | 90417-95-1 | 2A-0126403 |
| 3-(2-BROMOPHENYL)-5-(2,4-DICHLOROPHENYL)-1,2,4-OXADIAZOLE | 1000339-26-3 | 2A-0126730 |
| 3-(2-CHLORO-6-FLUOROBENZYL)PENTANE-2,4-DIONE | 175136-74-0 | 2A-0126782 |
| 3-(3-AMINOPHENYL)-5-METHYLIMIDAZOLIDINE-2,4-DIONE | 1214061-96-7 | 2A-0127082 |
| 3-(4-BROMOPHENYL)-5-(2,4-DICHLOROPHENYL)-1,2,4-OXADIAZOLE | 381178-19-4 | 2A-0127406 |
| 3-(5-FORMYL-2,4-DIMETHYL-1H-PYRROL-3-YL)PROPANOIC ACID | 1133-96-6 | 2A-1127763 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA