
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63720-38-7 |
| Catalog No. | 2A-0126278 |
| Chinese Name | 3-(1-氨基乙基)苯酚 |
| Synonyms | 3-(1-Aminoethyl)phenol; 3-Hydroxy-Alpha-methylbenzylamine |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 266.3±15.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2922299090 |
| UN(IATA) | 0 |
| PubChem ID | 38634447 |
| SMILES | CC(N)c1cccc(O)c1 |
| InChI | InChI=1S/C8H11NO/c1-6(9)7-3-2-4-8(10)5-7/h2-6,10H,9H2,1H3 |
| InChI Key | WFRNDUQAIZJRPZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)ACRYLIC ACID | 21937-88-2 | 2A-0126256 |
| 3-(1,3-THIAZOL-2-YL)BENZOIC ACID | 847956-27-8 | 2A-1126265 |
| 3-(1-AMINOETHYL)-1H-1,2,4-TRIAZOL-5(4H)-ONE | 401647-10-7 | 2A-0126275 |
| 3-(1-AMINOETHYL)ANILINE | 129725-48-0 | 2A-1126276 |
| 3-(1-AMINOETHYL)BENZONITRILE HYDROCHLORIDE | 153994-67-3 | 2A-1126277 |
| 3-(1-BENZYL-1H-INDOL-3-YL)PROPAN-1-OL | 29957-93-5 | 2A-0126280 |
| 3-(1-METHYL-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL | 116040-91-6 | 2A-0126287 |
| 3-(1-METHYL-1H-PYRAZOL-3-YL)ANILINE | 175202-37-6 | 2A-0126290 |
| 3-(1-METHYL-1H-PYRAZOL-3-YL)PROPAN-1-OL | 1014000-45-3 | 2A-0126291 |
| 3-(1-METHYL-1H-PYRAZOL-4-YL)PROPANOIC ACID | 796845-56-2 | 2A-0126292 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA