
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 915924-91-3 |
| Catalog No. | 2A-0126270 |
| Chinese Name | chembrdg-bb 4015546 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 165.23 |
| Purity | 96+ |
| Density | 1.013g/cm3 |
| Boiling Point | 239.3ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2922399090 |
| UN(IATA) | 0 |
| PubChem ID | 329783206 |
| MDL Number | MFCD08272688 |
| SMILES | CC(c1cccc(C=O)c1)N(C)C |
| InChI | InChI=1S/C11H15NO/c1-9(12(2)3)11-6-4-5-10(7-11)8-13/h4-9H,1-3H3 |
| InChI Key | VVBTYDOIRBJCJZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-((4-METHYLBENZYL)OXY)BENZALDEHYDE | 40359-58-8 | 2A-0126148 |
| 3-((DIETHYLAMINO)METHYL)-4-METHOXYBENZALDEHYDE | 128501-82-6 | 2A-0126178 |
| 3-((DIMETHYLAMINO)METHYL)BENZALDEHYDE | 80708-77-6 | 2A-0126180 |
| 3-((DIMETHYLAMINO)METHYL)PHENYLBORONIC ACID | 819849-22-4 | 2A-0126182 |
| 3-(1,2,4-OXADIAZOL-3-YL)BENZALDEHYDE | 1119450-74-6 | 2A-0126253 |
| 3-(1-METHYLETHOXY)BENZALDEHYDE | 75792-33-5 | 2A-0126295 |
| 3-(1H-IMIDAZOL-1-YL)-5-(TRIFLUOROMETHYL)BENZOIC ACID | 164341-38-2 | 2A-0126327 |
| 3-(1H-IMIDAZOL-4-YL)BENZALDEHYDE | 179056-81-6 | 2A-0126336 |
| 3-(1H-TETRAZOL-1-YL)BENZOHYDRAZIDE | 351994-81-5 | 2A-0126360 |
| 3-(2-(TRIFLUOROMETHYL)PHENYL)-1H-PYRAZOL-5-AMINE | 502133-02-0 | 2A-0126645 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA