
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 137788-51-3 |
| Catalog No. | 2A-0125854 |
| Chinese Name | 3-(2,3-二甲氧基苄胺)-1-丙醇 |
| Synonyms | 3-[(2,3-dimethoxyphenyl)methylamino]propan-1-ol |
| Molecular Formula | C15H24O2N4Cl2Si1 |
| Molecular Weight | 391.37 |
| Purity | 96+ |
| Boiling Point | 348.5ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 3206511 |
| MDL Number | MFCD35057969 |
| SMILES | COc1cccc(CNCCCO)c1OC |
| InChI | InChI=1S/C12H19NO3/c1-15-11-6-3-5-10(12(11)16-2)9-13-7-4-8-14/h3,5-6,13-14H,4,7-9H2,1-2H3/p+1 |
| InChI Key | UORGOETVDFBNAN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-((1-BENZYLPIPERIDIN-4-YL)OXY)PROPANENITRILE | 175203-64-2 | 2A-0125843 |
| 3-((1-METHYLPIPERIDIN-4-YL)OXY)PROPAN-1-AMINE | 1171770-24-3 | 2A-0125844 |
| 3-((1-PHENYLETHYL)AMINO)PROPAN-1-OL | 128218-35-9 | 2A-0125845 |
| 3-((1H-IMIDAZOL-4-YL)METHYL)-2-HYDROXYBENZAMIDE | 125472-02-8 | 2A-0125847 |
| 3-((1H-PYRAZOL-1-YL)METHYL)BENZOIC ACID | 562803-68-3 | 2A-0125848 |
| 3-((2,6-DIMETHYLPHENYL)AMINO)PHENOL | 180163-21-7 | 2A-0125884 |
| 3-((2-AMINOETHYL)AMINO)PROPANE-1-SULFONIC ACID | 14235-54-2 | 2A-0125901 |
| 3-((2-AMINOPHENYL)AMINO)-5,5-DIMETHYLCYCLOHEX-2-ENONE | 39222-69-0 | 2A-0125902 |
| 3-((2-ISOPROPYL-1H-IMIDAZOL-1-YL)METHYL)ANILINE | 1021062-16-7 | 2A-0125967 |
| 3-((2-OXOBENZO[D]OXAZOL-3(2H)-YL)METHYL)BENZONITRILE | 175277-77-7 | 2A-0125984 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA