
CAS Number5722-94-1
Synonyms3,4-Dimethoxy-2-methylbenzoic acid; 2-Methyl-3,4-dimethoxy-benzoesaeure; 2-Methyl-3,4-dimethoxybenzoic acid; 2-Methyl-veratrumsaeure; AmbkkkkK482; 3,4-Dimethoxy-2-methylbenzoicAcid; 3,4-Dimethoxy-2-methyl-benzoesaeure
Molecular FormulaC10H12O4
Molecular Weight196.2
Purity96+%
Density1.2±0.1 g/cm3
Boiling Point312.5±37.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5722-94-1 |
| Catalog No. | 2A-0125179 |
| Chinese Name | 2-甲基-3,4-二甲氧基苯甲酸 |
| Synonyms | 3,4-Dimethoxy-2-methylbenzoic acid; 2-Methyl-3,4-dimethoxy-benzoesaeure; 2-Methyl-3,4-dimethoxybenzoic acid; 2-Methyl-veratrumsaeure; AmbkkkkK482; 3,4-Dimethoxy-2-methylbenzoicAcid; 3,4-Dimethoxy-2-methyl-benzoesaeure |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.2 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 312.5±37.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| PubChem ID | 16899578 |
| SMILES | COc1ccc(C(=O)O)c(C)c1OC |
| InChI | InChI=1S/C10H12O4/c1-6-7(10(11)12)4-5-8(13-2)9(6)14-3/h4-5H,1-3H3,(H,11,12) |
| InChI Key | OUEJXYZKZCQELU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-8-CARBONITRILE HYDROCHLORIDE | 115661-89-7 | 2A-0125123 |
| 3,4-DIHYDRO-2H-PYRANO[3,2-B]PYRIDIN-4-AMINE | 502612-49-9 | 2A-0125132 |
| 3,4-DIHYDRO-7-METHYL-2H-1,4-BENZOTHIAZINE | 153953-26-5 | 2A-0125151 |
| 3,4-DIHYDROBENZO[B]OXEPIN-5(2H)-ONE | 6786-30-7 | 2A-0125154 |
| 3,4-DIHYDROXY-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE | 606492-26-6 | 2A-0125164 |
| 3,4-DIMETHOXYBENZAMIDE | 1521-41-1 | 2A-0125189 |
| 3,4-DIMETHYLBENZYL BROMIDE | 94416-66-7 | 2A-0125217 |
| 3,4-DIMETHYLISOXAZOL-5(2H)-ONE | 18655-21-5 | 2A-0125219 |
| 3,4-DIMETHYLISOXAZOL-5(4H)-ONE | 15731-93-8 | 2A-0125220 |
| 3,4-DIMETHYLISOXAZOL-5-OL | 29279-99-0 | 2A-0125222 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA