
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 615-56-5 |
| Catalog No. | 2A-0125015 |
| Chinese Name | 3,4-二溴苯酚 |
| Synonyms | 3,4-Dibrom-phenol; 3,4-dibromo-phenol; Phenol,3,4-dibromo; 3.4-Dibrom-1-hydroxy-benzol |
| Molecular Formula | C6H4Br2O |
| Molecular Weight | 251.90300 |
| Purity | 96+ |
| Density | 2.095g/cm3 |
| Boiling Point | 286.3ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| PubChem ID | 8158899 |
| SMILES | Oc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C6H4Br2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChI Key | KYZSNVXYOQKZAK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-BIS(PROPYLAMINO)CYCLOBUT-3-ENE-1,2-DIONE | 175204-26-9 | 2A-0124990 |
| 3,4-DIAMINOBENZENESULFONAMIDE | 2360-20-5 | 2A-0124996 |
| 3,4-DIAMINOBUTANOIC ACID | 131530-16-0 | 2A-0125001 |
| 3,4-DIAMINOPHENOL | 615-72-5 | 2A-0125002 |
| 3,4-DIBROMOBENZOIC ACID | 619-03-4 | 2A-0125012 |
| 3,4-DICHLORO-2-METHYLANILINE | 62077-25-2 | 2A-0125018 |
| 3,4-DICHLORO-6-FLUOROANILINE | 2729-36-4 | 2A-0125023 |
| 3,4-DICHLORO-N-METHYLANILINE | 40750-59-2 | 2A-0125026 |
| 3,4-DIETHYL-1-METHYL-1H-PYRAZOL-5-AMINE | 936940-25-9 | 2A-0125059 |
| 3,4-DIETHYLISOXAZOL-5-AMINE | 71378-51-3 | 2A-0125060 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA