
CAS Number83647-97-6
SynonymsRenormax; Spirapril [INN:BAN]; Espirapril [Spanish]; Setrilan; Spirapril (INN); Not established; Spiraprilum [Latin]; Sandopril; Spirapril
Molecular FormulaC22H30N2O5S2
Molecular Weight466.61400
Purity98%
Density1.32 g/cm3
Boiling Point697.8ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83647-97-6 |
| Catalog No. | 2A-9012499 |
| Chinese Name | 螺普利 |
| Synonyms | Renormax; Spirapril [INN:BAN]; Espirapril [Spanish]; Setrilan; Spirapril (INN); Not established; Spiraprilum [Latin]; Sandopril; Spirapril |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.61400 |
| Purity | 98 |
| Density | 1.32 g/cm3 |
| Boiling Point | 697.8ºC at 760 mmHg |
| Storage Condition | -20°C |
| Application | Spirapril is a potent cross-blood-brain barrier angiotensin-converting enzyme (ACE) inhibitor with antihypertensive activity. Spirapril competitively binds to ACE and prevents the conversion of angiot |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1CC2(CC1C(=O)O)SCCS2 |
| InChI | InChI=1S/C22H30N2O5S2/c1-3-29-21(28)17(10-9-16-7-5-4-6-8-16)23-15(2)19(25)24-14-22(30-11-12-31-22)13-18(24)20(26)27/h4-8,15,17-18,23H,3,9-14H2,1-2H3,(H,26,27)/t15?,17-,18?/m0/s1 |
| InChI Key | HRWCVUIFMSZDJS-SZMVWBNQSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/12499_1_83647_97_6.pdf |
| Transport Info | Product name: Luopuli |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Soretolide | 130403-08-6 | 2A-9012490 |
| Sornidipine | 95105-77-4 | 2A-9012491 |
| Sparfloxacin | 111542-93-9 | 2A-9012493 |
| Speciophylline | 4697-68-1 | 2A-9012494 |
| Spiramycin | 8025-81-8 | 2A-9012498 |
| Spiraprilat | 83602-05-5 | 2A-9012500 |
| Spirendolol | 65429-87-0 | 2A-9012501 |
| Spirodiclofen | 148477-71-8 | 2A-9012502 |
| Spizofurone | 72492-12-7 | 2A-9012504 |
| Starane | 81406-37-3 | 2A-9012505 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA