
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 89281-44-7 |
| Catalog No. | 2A-0124040 |
| Chinese Name | 2-甲基-5-噻唑胺 |
| Synonyms | 2-methyl-1,3-thiazol-5-amine |
| Molecular Formula | C4H6N2S |
| Molecular Weight | 114.17 |
| Purity | 96+ |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| EINECS | 0 |
| HTC | 2934100090 |
| UN(IATA) | 0 |
| PubChem ID | 34170142 |
| SMILES | Cc1ncc(N)s1 |
| InChI | InChI=1S/C4H6N2S/c1-3-6-2-4(5)7-3/h2H,5H2,1H3 |
| InChI Key | IDSUZAVUCMIBBS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-METHYLOXAZOL-5-AMINE | 153138-07-9 | 2A-1123968 |
| 2-METHYLQUINAZOLIN-4-AMINE | 3440-46-8 | 2A-0124010 |
| 2-METHYLQUINOLIN-3-OL | 613-19-4 | 2A-0124013 |
| 2-METHYLQUINOLIN-5-OL | 607-72-7 | 2A-0124016 |
| 2-METHYLTHIAZOL-4-AMINE | 103392-01-4 | 2A-0124039 |
| 2-MORPHOLINO-2,3-DIHYDRO-1H-INDENE-2-CARBONITRILE | 1157501-77-3 | 2A-0124070 |
| 2-MORPHOLINO-N-(PYRIDIN-3-YLMETHYL)ETHANAMINE | 136469-98-2 | 2A-0124075 |
| 2-MORPHOLINO-N-(PYRIDIN-4-YLMETHYL)ETHANAMINE | 626209-60-7 | 2A-0124076 |
| 2-MORPHOLINONICOTINONITRILE | 59025-37-5 | 2A-0124085 |
| 2-MORPHOLINOPROPAN-1-AMINE | 1005-04-5 | 2A-0124087 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA