
CAS Number1706-11-2
Synonyms2-Methoxy-1,4-dimethylbenzene; 2-Methoxy-p-xylene; 2,5-Dimethylphenyl methyl ether; 2,5-DiMethylanisole; EINECS 216-943-8; MFCD00008378
Molecular Formula(CH3)2C6H3OCH3
Molecular Weight136.19
Purity96+%
Density0.9±0.1 g/cm3
Boiling Point189.7±9.0 °C at 760 mmHg
Appearancecolorless liquid
EINECS216-943-8
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1706-11-2 |
| Catalog No. | 2A-0123217 |
| Chinese Name | 2,5-二甲基苯甲醚 |
| Synonyms | 2-Methoxy-1,4-dimethylbenzene; 2-Methoxy-p-xylene; 2,5-Dimethylphenyl methyl ether; 2,5-DiMethylanisole; EINECS 216-943-8; MFCD00008378 |
| Molecular Formula | (CH3)2C6H3OCH3 |
| Molecular Weight | 136.19 |
| Purity | 96+ |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 189.7±9.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| EINECS | 216-943-8 |
| HTC | 2909309090 |
| UN(IATA) | 0 |
| PubChem ID | 24848330 |
| MDL Number | MFCD00008378 |
| SMILES | COc1cc(C)ccc1C |
| InChI | InChI=1S/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| InChI Key | SJZAUIVYZWPNAS-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-MERCAPTO-3-(2-METHOXYPHENYL)QUINAZOLIN-4(3H)-ONE | 1031-67-0 | 2A-0123185 |
| 2-MERCAPTO-3-(4-METHOXYPHENYL)QUINAZOLIN-4(3H)-ONE | 1031-88-5 | 2A-0123186 |
| 2-MERCAPTO-5,6,7,8-TETRAHYDROQUINAZOLIN-4-OL | 16064-21-4 | 2A-0123193 |
| 2-MERCAPTO-5-METHOXYPYRIMIDIN-4-OL | 6963-11-3 | 2A-0123199 |
| 2-MESITYLACETIMIDAMIDE | 173601-36-0 | 2A-0123211 |
| 2-METHOXY-2-METHYLPROPAN-1-OL | 22665-67-4 | 2A-0123223 |
| 2-METHOXY-2-METHYLPROPANOIC ACID | 13836-62-9 | 2A-0123224 |
| 2-METHOXY-3-METHYLANILINE | 18102-30-2 | 2A-0123236 |
| 2-METHOXY-3-METHYLBENZOIC ACID | 26507-91-5 | 2A-0123238 |
| 2-METHOXY-4,6-DIMETHYLBENZONITRILE | 854854-61-8 | 2A-0123250 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA