
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 601-99-0 |
| Catalog No. | 2A-0122954 |
| Chinese Name | 2-羟基-6-硝基苯甲酸 |
| Synonyms | 2-hydroxy-6-nitro-benzoic acid; Benzoic acid,2-hydroxy-6-nitro; 6-Nitrosalicylsaeure; 2-Hydroxy-6-nitro-benzoesaeure |
| Molecular Formula | HOC6H3(NO2)CO2H |
| Molecular Weight | 183.12 |
| Purity | 96+ |
| Storage Condition | room temperature, dry |
| EINECS | 210-584-0 |
| HTC | 2918290000 |
| UN(IATA) | 0 |
| PubChem ID | 24847317 |
| MDL Number | MFCD00071505 |
| SMILES | O=C(O)c1c(O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO5/c9-5-3-1-2-4(8(12)13)6(5)7(10)11/h1-3,9H,(H,10,11) |
| InChI Key | QICHZWUWPVMQTD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-HYDROXY-5-NITROBENZONITRILE | 39835-09-1 | 2A-0122930 |
| 2-HYDROXY-5-PENTYLBENZOIC ACID | 28488-46-2 | 2A-0122934 |
| 2-HYDROXY-6-METHOXYNAPHTHALENE-1,4-DIONE | 6223-31-0 | 2A-0122943 |
| 2-HYDROXY-6-METHYL-4H-PYRAN-4-ONE | 70254-61-4 | 2A-0122945 |
| 2-HYDROXY-6-METHYLBENZAMIDE | 27177-82-8 | 2A-0122946 |
| 2-HYDROXY-N-(5-NITROTHIAZOL-2-YL)BENZAMIDE | 173903-47-4 | 2A-0122964 |
| 2-HYDROXY-N-METHYL-N-PYRIDIN-4-YLMETHYLBENZAMIDE | 1155058-96-0 | 2A-0122965 |
| 2-HYDROXYCYCLOPENT-2-EN-1-ONE | 10493-98-8 | 2A-0122977 |
| 2-HYDROXYDOCOSANOIC ACID | 13980-14-8 | 2A-0122978 |
| 2-HYDROXYHEXADECANOIC ACID | 764-67-0 | 2A-0122980 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA