
CAS Number465-39-4
Synonyms(3b,5b,15b)-14,15-Epoxy-3-hydroxy-5-bufa-20,22-dienolide; Respigon; bufogenin; Resi (VAN); 20,22,5BETA-BUFADIENOLID-14BETA,15BETA-EPOXY-3BETA-OL; Resi; 3β-Hydroxy-14,15β-epoxy-5β-bufa-20,22-dienolide; (3β,5β,15β)-3-Hydroxy-14,15-epoxybufa-20,22-dienolide; 14,15β-Epoxy-3β-hydroxy-5β-bufa-20,22-dienolide; RBG; Resibufogenin; bufogenina; resibufagenin; Recibufogenin
Molecular FormulaC24H32O4
Molecular Weight384.51
Purity≥98 (HPLC)%
Density1.3±0.1 g/cm3
Boiling Point554.9±50.0 °C at 760 mmHg
Melting Point155ºC
Appearancepowder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 465-39-4 |
| Catalog No. | 2A-9012290 |
| Chinese Name | 酯蟾毒配基,蟾力苏 |
| Synonyms | (3b,5b,15b)-14,15-Epoxy-3-hydroxy-5-bufa-20,22-dienolide; Respigon; bufogenin; Resi (VAN); 20,22,5BETA-BUFADIENOLID-14BETA,15BETA-EPOXY-3BETA-OL; Resi; 3β-Hydroxy-14,15β-epoxy-5β-bufa-20,22-dienolide; (3β,5β,15β)-3-Hydroxy-14,15-epoxybufa-20,22-dienolide; 14,15β-Epoxy-3β-hydroxy-5β-bufa-20,22-dienolide; RBG; Resibufogenin; bufogenina; resibufagenin; Recibufogenin |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.51 |
| Purity | ≥98 (HPLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 554.9±50.0 °C at 760 mmHg |
| Melting Point | 155ºC |
| Appearance | powder |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| Packaging | II |
| Application | Resibufogenin is a component of cinobufogenin and has the function of inhibiting oxidative stress and tumor regeneration. |
| PubChem ID | 329825011 |
| MDL Number | MFCD00210361 |
| SMILES | C[C@@]12[C@@]3(O[C@@H]3C[C@@H]2C4=COC(C=C4)=O)[C@]5([H])CC[C@]6([H])C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC1 |
| InChI | 1S/C24H32O4/c1-22-9-7-16(25)11-15(22)4-5-18-17(22)8-10-23(2)19(12-20-24(18,23)28-20)14-3-6-21(26)27-13-14/h3,6,13,15-20,25H,4-5,7-12H2,1-2H3/t15-,16+,17+,18-,19-,20-,22+,23-,24-/m1/s1 |
| InChI Key | ATLJNLYIJOCWJE-CWMZOUAVSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352205 |
| Hazard Symbols | 6.1(a) |
| MSDS | msds/12290_1_465_39_4.pdf |
| Transport Info | Product name: Lesobufa ligand |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Remoxipride | 80125-14-0 | 2A-9012283 |
| Rentiapril | 80830-42-8 | 2A-9012284 |
| Repirinast | 73080-51-0 | 2A-9012286 |
| Rescimetol | 73573-42-9 | 2A-9012287 |
| Reseveratrol | 2A-303373 | 2A-9012289 |
| Resocortol | 76675-97-3 | 2A-9012291 |
| Resorcinol sulfide | 97-29-0 | 2A-9012292 |
| Revizinone | 133718-29-3 | 2A-9012294 |
| Rhaponticin | 155-58-8 | 2A-9012295 |
| Rhoeadine | 2718-25-4 | 2A-9012296 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA