
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81846-19-7 |
| Catalog No. | 2A-9012282 |
| Chinese Name | 曲前列尼尔 |
| Synonyms | Remodulin; treprostinol; Uniprost; LRX-15; UNII-RUM6K67ESG; 15AU81; Treprostinil; Tyvaso |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.51 |
| Purity | ≥98 (HPLC) |
| Density | 1.158g/cm3 |
| Boiling Point | 587.1ºC at 760mmHg |
| Melting Point | 121-123° |
| Appearance | powder |
| Storage Condition | Room temperature, dry |
| Application | Treprostinil sodium is a highly efficient DP1 and EP2 agonist with EC50 values of 0.6±0.1 and 6.2±1.2 nM respectively. |
| MDL Number | MFCD00888847 |
| SMILES | [H][C@@]12[C@@](C[C@@H](O)[C@@H]2CC[C@@H](O)CCCCC)([H])CC3=C(OCC(O)=O)C=CC=C3C1 |
| InChI | 1S/C23H34O5.Na/c1-2-3-4-7-17(24)9-10-18-19-11-15-6-5-8-22(28-14-23(26)27)20(15)12-16(19)13-21(18)25;/h5-6,8,16-19,21,24-25H,2-4,7,9-14H2,1H3,(H,26,27);/q;+1/p-1/t16-,17-,18+,19-,21+;/m1./s1 |
| InChI Key | IQKAWAUTOKVMLE-DQHZMXPSSA-M |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/12282_1_81846_19_7.pdf |
| Transport Info | Product Name: Rimodulin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Red clover P.E. | 2A-303360 | 2A-9012276 |
| Red Clover P.E. | 2A-303361 | 2A-9012277 |
| Redix Ephedrae | 2A-303362 | 2A-9012278 |
| Relomycin | 1404-48-4 | 2A-9012279 |
| Remiprostol | 110845-89-1 | 2A-9012281 |
| Remoxipride | 80125-14-0 | 2A-9012283 |
| Rentiapril | 80830-42-8 | 2A-9012284 |
| Repirinast | 73080-51-0 | 2A-9012286 |
| Rescimetol | 73573-42-9 | 2A-9012287 |
| Reseveratrol | 2A-303373 | 2A-9012289 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA