| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3906-87-4 |
| Catalog No. | 2A-0122754 |
| Chinese Name | 2-氟对苯二甲酸 |
| Synonyms | 2-Fluoroterephthalic acid; 2-Fluoro-1,4-benzenedicarboxylic acid; 2-Fluorobenzene-1,4-dicarboxylic acid; QVR BF DVQ |
| Molecular Formula | C8H5FO4 |
| Molecular Weight | 184.12 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 381.5±27.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2915900090 |
| UN(IATA) | 0 |
| PubChem ID | 418893 |
| SMILES | O=C(O)c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C8H5FO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChI Key | YUWKPDBHJFNMAD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-FLUOROCYCLOHEXANONE | 694-82-6 | 2A-0122727 |
| 2-FLUOROETHANAMINE | 406-34-8 | 2A-0122729 |
| 2-FLUOROETHYLAMINE HYDROCHLORIDE | 460-08-2 | 2A-1122731 |
| 2-FLUOROHEXADECANOIC ACID | 16518-94-8 | 2A-0122732 |
| 2-FLUORONAPHTHALENE | 323-09-1 | 2A-0122737 |
| 2-FORMYLISONICOTINIC ACID | 855636-38-3 | 2A-0122769 |
| 2-HEPTYL-2-(HYDROXYMETHYL)PROPANE-1,3-DIOL | 4780-30-7 | 2A-0122781 |
| 2-HEPTYLCYCLOPENTANONE | 137-03-1 | 2A-0122783 |
| 2-HEXYLCYCLOPENTANONE | 13074-65-2 | 2A-0122785 |
| 2-HYDRAZINO-3-METHYLBUTANOIC ACID | 60047-26-9 | 2A-0122788 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS