
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1578-62-7 |
| Catalog No. | 2A-0122421 |
| Chinese Name | 2-氟-3-甲基丁酸 |
| Synonyms | 2-fluoro-3-methylbutanoic acid |
| Molecular Formula | C7H3O4N1Cl1F1 |
| Molecular Weight | 120.12200 |
| Purity | 96+ |
| Density | 1.073g/cm3 |
| Boiling Point | 182ºC at 760mmHg |
| Melting Point | 35-40ºC |
| EINECS | 0 |
| HTC | 2915900090 |
| UN(IATA) | 0 |
| PubChem ID | 122139 |
| MDL Number | MFCD12173034 |
| SMILES | CC(C)C(F)C(=O)O |
| InChI | InChI=1S/C5H9FO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8) |
| InChI Key | DPPSUGSPUHMWEH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-FLUORO-1-METHOXY-4-(METHYLSULFONYL)BENZENE | 20951-14-8 | 2A-0122368 |
| 2-FLUORO-1-PHENYLETHANONE | 450-95-3 | 2A-0122371 |
| 2-FLUORO-2'-NITROBENZOPHENONE | 30682-54-3 | 2A-0122374 |
| 2-FLUORO-3-(TRIFLUOROMETHOXY)BENZENAMINE | 1159512-64-7 | 2A-0122386 |
| 2-FLUORO-3-METHYL-6-NITROANILINE | 1261676-68-9 | 2A-0122417 |
| 2-FLUORO-3-NITROBENZOTRIFLUORIDE | 61324-97-8 | 2A-1122432 |
| 2-FLUORO-4'-HYDROXY-[1,1'-BIPHENYL]-3-CARBONITRILE | 1261951-45-4 | 2A-0122440 |
| 2-FLUORO-4,5-DIMETHOXYBENZOIC ACID | 79474-35-4 | 2A-0122445 |
| 2-FLUORO-4-(PIPERIDIN-3-YLOXY)BENZONITRILE | 1063734-68-8 | 2A-0122463 |
| 2-FLUORO-4-IODO-1-NITROBENZENE | 2996-31-8 | 2A-0122488 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA