
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1204176-39-5 |
| Catalog No. | 2A-0122408 |
| Chinese Name | 2-氟-3-异丙氧基苯甲醛 |
| Molecular Formula | FC6H3(OCH3)NH2 |
| Molecular Weight | 141.14 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 329764618 |
| MDL Number | MFCD00007759 |
| SMILES | CC(C)Oc1cccc(C=O)c1F |
| InChI | InChI=1S/C10H11FO2/c1-7(2)13-9-5-3-4-8(6-12)10(9)11/h3-7H,1-2H3 |
| InChI Key | YVPHKCJZJMJSJY-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-FLUORO-[1,1'-BIPHENYL]-4,4'-DICARBOXYLIC ACID | 1261943-47-8 | 2A-0122357 |
| 2-FLUORO-1,3-BIS(TRIFLUOROMETHYL)BENZENE | 887268-09-9 | 2A-0122359 |
| 2-FLUORO-1-METHYL-3-(TRIFLUOROMETHYL)BENZENE | 1214331-63-1 | 2A-0122369 |
| 2-FLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE | 1112209-40-1 | 2A-0122380 |
| 2-FLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE | 1218791-15-1 | 2A-0122381 |
| 2-FLUORO-4-(1H-PYRAZOL-1-YL)BENZALDEHYDE | 433920-90-2 | 2A-0122449 |
| 2-FLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE | 503176-50-9 | 2A-0122450 |
| 2-FLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOIC ACID | 867256-77-7 | 2A-0122451 |
| 2-FLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL | 760990-08-7 | 2A-1122452 |
| 2-FLUORO-4-(METHYLSULFONYL)PHENYLBORONIC ACID | 957060-85-4 | 2A-0122461 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA