![2-CHLORO-7-FLUOROBENZO[D]THIAZOLE structure, CAS 154327-28-3](/structures/150000/121656_2_154327_28_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 154327-28-3 |
| Catalog No. | 2A-0121656 |
| Chinese Name | 2-氯-7-氟苯并[D]噻唑 |
| Synonyms | 2-chloro-7-fluoro-benzothiazole |
| Molecular Formula | C7H3ClFNS |
| Molecular Weight | 187.62 |
| Purity | 96+ |
| Density | 1.532±0.06 g/cm3(Predicted) |
| Boiling Point | 253.0±13.0℃(Predicted) |
| Appearance | Yellow to brown liquid |
| Storage Condition | 2-8℃, dry, sealed |
| EINECS | 0 |
| HTC | 2934200090 |
| UN(IATA) | 0 |
| PubChem ID | 16841526 |
| SMILES | Fc1cccc2nc(Cl)sc12 |
| InChI | InChI=1S/C7H3ClFNS/c8-7-10-5-3-1-2-4(9)6(5)11-7/h1-3H |
| InChI Key | GQPCQNLKLWGDIX-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-CHLORO-6-NITROPYRAZINE | 195073-19-9 | 2A-0121638 |
| 2-CHLORO-6-PHENYLPYRIDINE | 13382-54-2 | 2A-0121646 |
| 2-CHLORO-7,8-DIMETHYL-2H-PYRIMIDO[1,2-B]PYRIDAZINE | 17412-26-9 | 2A-0121653 |
| 2-CHLORO-7-FLUORO-4-METHYLQUINOLINE | 271241-25-9 | 2A-0121654 |
| 2-CHLORO-7-FLUOROBENZO[D]OXAZOLE | 153403-52-2 | 2A-0121655 |
| 2-CHLORO-7-METHOXY-4-METHYLQUINOLINE | 97892-67-6 | 2A-0121665 |
| 2-CHLORO-7-METHOXYQUINOLINE | 49609-15-6 | 2A-0121666 |
| 2-CHLORO-7-METHYL-1H-BENZO[D]IMIDAZOLE | 15965-57-8 | 2A-0121668 |
| 2-CHLORO-7-METHYL-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE | 17326-18-0 | 2A-0121669 |
| 2-CHLORO-7-NITROBENZO[D]THIAZOLE | 2942-22-5 | 2A-0121673 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA