
CAS Number29242-84-0
Synonyms2-Chloro-4-anisidine; 2-chloro-4-methoxybenzenamine; 2-Chloro-4-methoxy-phenylamine; 4-Methoxy-2-chloroaniline; 3-chloro-4-amino-anisole; 2-Chloro-4-methoxyaniline; 2-chloro-p-anisidine; 2-Chloro-4-methoxybenzamine; 2-chloro-4-methoxy-aniline
Molecular FormulaC7H8ClNO
Molecular Weight157.6
Purity96+%
Density1.2±0.1 g/cm3
Boiling Point249.2±20.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29242-84-0 |
| Catalog No. | 2A-0121085 |
| Chinese Name | 2-氯-4-甲氧基苯胺 |
| Synonyms | 2-Chloro-4-anisidine; 2-chloro-4-methoxybenzenamine; 2-Chloro-4-methoxy-phenylamine; 4-Methoxy-2-chloroaniline; 3-chloro-4-amino-anisole; 2-Chloro-4-methoxyaniline; 2-chloro-p-anisidine; 2-Chloro-4-methoxybenzamine; 2-chloro-4-methoxy-aniline |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.6 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 249.2±20.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2922299090 |
| UN(IATA) | 0 |
| PubChem ID | 5487164 |
| SMILES | COc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C7H8ClNO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChI Key | LNEVUNYUJNORRV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-4-FLUORO-1-ISOPROPOXYBENZENE | 202982-71-6 | 2A-0121016 |
| 2-CHLORO-4-FLUORO-3-METHYL-1-NITROBENZENE | 90292-62-9 | 2A-0121019 |
| 2-CHLORO-4-FLUOROPHENYL HYDROGEN CARBONATE | 141852-65-5 | 2A-0121048 |
| 2-CHLORO-4-HYDRAZINOBENZOIC ACID | 700795-33-1 | 2A-0121055 |
| 2-CHLORO-4-IODONICOTINIC ACID | 544671-78-5 | 2A-0121073 |
| 2-CHLORO-4-METHYL-1-(TRIFLUOROMETHOXY)BENZENE | 75462-60-1 | 2A-0121099 |
| 2-CHLORO-4-METHYL-6-NITROPHENYLAMINE | 5465-33-8 | 2A-0121107 |
| 2-CHLORO-4-METHYLNICOTINIC ACID | 142266-63-5 | 2A-0121119 |
| 2-CHLORO-4-METHYLPYRIDIN-3-AMINE | 133627-45-7 | 2A-0121123 |
| 2-CHLORO-4-METHYLPYRIDIN-3-OL | 884494-70-6 | 2A-0121124 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA