
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1260764-27-9 |
| Catalog No. | 2A-0121021 |
| Chinese Name | 2-氯-4-氟-2-甲基苯甲醛 |
| Synonyms | 2-Chloro-4-fluoro-3-methylbenzaldehyde; 2-chloro-4-fluoro-3-methybenzaldehyde; cl8266 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.59 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 230.1±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 160820378 |
| SMILES | Cc1c(F)ccc(C=O)c1Cl |
| InChI | InChI=1S/C8H6ClFO/c1-5-7(10)3-2-6(4-11)8(5)9/h2-4H,1H3 |
| InChI Key | PGJRBNFHJDSMPA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-CHLORO-4-(PIPERIDIN-1-YL)BENZALDEHYDE | 886501-12-8 | 2A-0120969 |
| 2-CHLORO-4-(PYRROLIDIN-1-YL)BENZALDEHYDE | 886500-65-8 | 2A-0120975 |
| 2-CHLORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE | 82096-91-1 | 2A-0120984 |
| 2-CHLORO-4-(TRIFLUOROMETHYL)NICOTINONITRILE | 896447-72-6 | 2A-0120991 |
| 2-CHLORO-4-BROMO-5-FLUOROBENZALDEHYDE | 1214386-29-4 | 2A-1120998 |
| 2-CHLORO-4-FLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE | 1218790-13-6 | 2A-0121025 |
| 2-CHLORO-4-FLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL | 1256360-20-9 | 2A-0121026 |
| 2-CHLORO-4-METHOXYBENZALDEHYDE | 54439-75-7 | 2A-0121086 |
| 2-CHLORO-4-METHYLNICOTINALDEHYDE | 884495-45-8 | 2A-0121117 |
| 2-CHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE | 850567-56-5 | 2A-0121195 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA