
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16668-45-4 |
| Catalog No. | 2A-0120730 |
| Chinese Name | 2-氯-2-(3,5,7-三甲基金刚烷-1-基)乙酸 |
| Synonyms | 3.5.7-Trimethyl-1-adamantan-chloressigsaeure |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.802 |
| Purity | 96+ |
| Density | 1.23g/cm3 |
| Boiling Point | 354.6ºC at 760mmHg |
| EINECS | 0 |
| HTC | 2916209090 |
| UN(IATA) | 0 |
| PubChem ID | 414527 |
| MDL Number | MFCD00154388 |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C(Cl)C(=O)O)(C2)C3 |
| InChI | InChI=1S/C15H23ClO2/c1-12-4-13(2)6-14(3,5-12)9-15(7-12,8-13)10(16)11(17)18/h10H,4-9H2,1-3H3,(H,17,18) |
| InChI Key | AIPDCMZNOXKOBM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-1-FLUORO-4-(METHYLSULFONYL)BENZENE | 847148-17-8 | 2A-0120698 |
| 2-CHLORO-1-IODO-3-METHYLBENZENE | 116632-40-7 | 2A-3120701 |
| 2-CHLORO-1-ISOCYANATO-4-METHYLBENZENE | 40398-00-3 | 2A-0120703 |
| 2-CHLORO-1-METHYLPIPERIDIN-4-ONE | 17228-68-1 | 2A-0120711 |
| 2-CHLORO-2,6-DIMETHYLHEPTANE | 14093-16-4 | 2A-0120729 |
| 2-CHLORO-2-METHYLOCTANE | 928-60-9 | 2A-0120733 |
| 2-CHLORO-3,4-DIMETHOXY-6-NITROBENZONITRILE | 175136-28-4 | 2A-0120736 |
| 2-CHLORO-3,5,5-TRIMETHYLCYCLOHEX-2-ENONE | 17304-82-4 | 2A-0120740 |
| 2-CHLORO-3-(2-METHOXYETHYLAMINO)NAPHTHALENE-1,4-DIONE | 22272-22-6 | 2A-0120763 |
| 2-CHLORO-3-FLUOROPYRIDIN-4-AMINE | 1227577-03-8 | 2A-0120821 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA