
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 132560-67-9 |
| Catalog No. | 2A-0120674 |
| Chinese Name | 2-氯-1-(4-丙基苯基)-(9ci)-1-丙酮 |
| Synonyms | 1-Propanone,2-chloro-1-(4-propylphenyl); 2-Chloro-1-(4-propyl-phenyl)-propan-1-one |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 176.25 |
| Purity | 96+ |
| Density | 1.061g/cm3 |
| Boiling Point | 309.3ºC at 760mmHg |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 329773068 |
| MDL Number | MFCD21984534 |
| SMILES | CCCc1ccc(C(=O)C(C)Cl)cc1 |
| InChI | InChI=1S/C12H15ClO/c1-3-4-10-5-7-11(8-6-10)12(14)9(2)13/h5-9H,3-4H2,1-2H3/t9-/m1/s1 |
| InChI Key | CNXBHEBHRAOFOB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-1-(2-CHLORO-3-FLUOROPHENYL)ETHANONE | 1214362-75-0 | 2A-0120657 |
| 2-CHLORO-1-(2-CHLORO-5-FLUOROPHENYL)ETHANONE | 1214391-59-9 | 2A-0120658 |
| 2-CHLORO-1-(2-METHYL-1HBENZIMIDAZOL-1-YL)-ETHANONE | 901346-69-8 | 2A-0120659 |
| 2-CHLORO-1-(4-(4-NITROPHENYL)PIPERAZIN-1-YL)ETHANONE | 16264-11-2 | 2A-0120666 |
| 2-CHLORO-1-(4-ETHYLPHENYL)PROPAN-1-ONE | 132560-66-8 | 2A-0120668 |
| 2-CHLORO-1-(5-METHYLTHIOPHEN-2-YL)ETHANONE | 31772-42-6 | 2A-0120675 |
| 2-CHLORO-1-(6,7-DIMETHOXY-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ETHANONE | 111631-72-2 | 2A-0120676 |
| 2-CHLORO-1-(CYCLOPROPYLMETHOXY)-4-FLUOROBENZENE | 1314985-41-5 | 2A-0120678 |
| 2-CHLORO-1-(ETHYLSULFONYL)-4-FLUOROBENZENE | 1062559-01-6 | 2A-0120681 |
| 2-CHLORO-1-(INDOLIN-1-YL)ETHANONE | 17133-48-1 | 2A-0120682 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA