
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 131023-37-5 |
| Catalog No. | 2A-0120655 |
| Chinese Name | 2-氯-1-(2,7-二氯-9h-芴-4-基)乙酮 |
| Synonyms | MFCD11846253 |
| Molecular Formula | C15H9O1Cl3 |
| Molecular Weight | 311.59 |
| Purity | 96+ |
| Storage Condition | 2-8°C, dry, sealed |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 176237077 |
| MDL Number | MFCD11846253 |
| SMILES | O=C(CCl)c1cc(Cl)cc2c1-c1ccc(Cl)cc1C2 |
| InChI | InChI=1S/C15H9Cl3O/c16-7-14(19)13-6-11(18)5-9-3-8-4-10(17)1-2-12(8)15(9)13/h1-2,4-6H,3,7H2 |
| InChI Key | FUSJWQRNFMDEGH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-CHLORO-1-(1-(2-FLUOROPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-YL)ETHANONE | 565170-64-1 | 2A-0120645 |
| 2-CHLORO-1-(1-(3-FLUOROPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-YL)ETHANONE | 315710-85-1 | 2A-0120646 |
| 2-CHLORO-1-(1-METHYL-1H-PYRROL-2-YL)ETHANONE | 23694-02-2 | 2A-0120647 |
| 2-CHLORO-1-(1H-INDOL-3-YL)PROPAN-1-ONE | 17380-07-3 | 2A-0120649 |
| 2-CHLORO-1-(2,2,4-TRIMETHYL-3,4-DIHYDROQUINOLIN-1(2H)-YL)ETHANONE | 14036-98-7 | 2A-0120651 |
| 2-CHLORO-1-(2-CHLORO-10H-PHENOTHIAZIN-10-YL)ETHANONE | 16189-69-8 | 2A-0120656 |
| 2-CHLORO-1-(2-CHLORO-3-FLUOROPHENYL)ETHANONE | 1214362-75-0 | 2A-0120657 |
| 2-CHLORO-1-(2-CHLORO-5-FLUOROPHENYL)ETHANONE | 1214391-59-9 | 2A-0120658 |
| 2-CHLORO-1-(2-METHYL-1HBENZIMIDAZOL-1-YL)-ETHANONE | 901346-69-8 | 2A-0120659 |
| 2-CHLORO-1-(4-(4-NITROPHENYL)PIPERAZIN-1-YL)ETHANONE | 16264-11-2 | 2A-0120666 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA