
CAS Number15987-00-5
Synonyms2-Butyl-3-methylpyrazine; EINECS 240-126-5; 2-N-BUTYL-3-METHYLPYRAZINE
Molecular FormulaC9H14N2
Molecular Weight136.15
Purity96+%
Density1.0±0.1 g/cm3
Boiling Point215.3±35.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Brown clear liquid
EINECS245-889-8
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15987-00-5 |
| Catalog No. | 2A-0120591 |
| Chinese Name | 2-丁基-3-甲基吡嗪 |
| Synonyms | 2-Butyl-3-methylpyrazine; EINECS 240-126-5; 2-N-BUTYL-3-METHYLPYRAZINE |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 136.15 |
| Purity | 96+ |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 215.3±35.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Brown clear liquid |
| Storage Condition | Room temperature, sealed, dry |
| EINECS | 245-889-8 |
| HTC | 2933990090 |
| UN(IATA) | 0 |
| PubChem ID | 24901956 |
| MDL Number | MFCD00014612 |
| SMILES | CCCCc1nccnc1C |
| InChI | InChI=1S/C9H14N2/c1-3-4-5-9-8(2)10-6-7-11-9/h6-7H,3-5H2,1-2H3 |
| InChI Key | IRSIKJPEFMMRHD-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-BROMOTHIENO[3,2-B]PYRIDINE | 94191-15-8 | 2A-0120568 |
| 2-BROMOTHIENO[3,2-B]THIOPHENE | 25121-82-8 | 2A-0120569 |
| 2-BROMOTHIENO[3,2-C]PYRIDINE | 94226-20-7 | 2A-0120571 |
| 2-BUTOXY-4,6-DICHLORO-1,3,5-TRIAZINE | 13838-32-9 | 2A-0120577 |
| 2-BUTYL-2H-BENZO[D][1,2,3]TRIAZOLE | 16584-01-3 | 2A-0120588 |
| 2-BUTYL-4-CHLOROQUINOLINE | 144624-27-1 | 2A-0120595 |
| 2-BUTYL-5,6-DICHLORO-1H-BENZO[D]IMIDAZOLE | 133052-59-2 | 2A-0120596 |
| 2-BUTYLBENZOFURAN-5-AMINE HYDROCHLORIDE | 526196-90-7 | 2A-1120603 |
| 2-CHLORO-1,3,4-THIADIAZOLE | 52819-57-5 | 2A-0120627 |
| 2-CHLORO-1-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-IMIDAZOLE | 1315281-29-8 | 2A-0120710 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA