
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 155991-28-9 |
| Catalog No. | 2A-0120354 |
| Chinese Name | 2-溴-6-苯基环己酮 |
| Synonyms | 2-bromo-6-phenylcyclohexanone |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 172.02 |
| Purity | 96+ |
| Boiling Point | 338.6ºC at 760 mmHg |
| EINECS | 226-173-4 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 24866838 |
| MDL Number | MFCD00040743 |
| SMILES | O=C1C(Br)CCCC1c1ccccc1 |
| InChI | InChI=1S/C12H13BrO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2 |
| InChI Key | NHQHKAJHEKEFEL-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-6-METHOXY-4-METHYLPYRIDIN-3-AMINE | 135795-51-6 | 2A-0120314 |
| 2-BROMO-6-METHOXYBENZONITRILE | 1245647-50-0 | 2A-0120318 |
| 2-BROMO-6-METHOXYISONICOTINIC ACID | 853029-93-3 | 2A-0120320 |
| 2-BROMO-6-METHOXYPHENOL | 28165-49-3 | 2A-0120322 |
| 2-BROMO-6-METHYLNICOTINONITRILE | 155265-57-9 | 2A-0120337 |
| 2-BROMO-7,8,9,10-TETRAHYDROAZEPINO[2,1-B]QUINAZOLIN-12(6H)-ONE | 61938-69-0 | 2A-0120358 |
| 2-BROMO-7-METHYLNAPHTHALENE | 187746-76-5 | 2A-1120367 |
| 2-BROMO-9,9-DIBUTYL-9H-FLUORENE | 88223-35-2 | 2A-0120375 |
| 2-BROMO-N,2-DIMETHYLPROPANAMIDE | 69959-88-2 | 2A-0120383 |
| 2-BROMO-N,N-DIETHYL-4-NITROANILINE | 1150271-18-3 | 2A-0120384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA