
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2040-86-0 |
| Catalog No. | 2A-0120306 |
| Chinese Name | 2-溴-6-碘苯酚 |
| Synonyms | PHENOL,2-BROMO-6-IODO; 2-Brom-6-iod-phenol |
| Molecular Formula | C6H4BrIO |
| Molecular Weight | 298.91 |
| Purity | 96+ |
| Density | 2.369±0.06 g/cm3 |
| Boiling Point | 214.4±25.0 °C |
| Melting Point | 63 °C |
| Appearance | coffee color solid |
| Storage Condition | 2-8°C, protected from light, dry |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| PubChem ID | 55610310 |
| SMILES | Oc1c(Br)cccc1I |
| InChI | InChI=1S/C6H4BrIO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| InChI Key | ZZBRPSNXUDZTRX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| 2-AMINO-5-UREIDOPENTANOIC ACID | 627-77-0 | 2A-0118768 |
| 2-BENZYL-5-IODOPYRIDAZIN-3(2H)-ONE | 825633-93-0 | 2A-0119335 |
| 2-BROMO-4,6-DIIODOPYRIDIN-3-OL | 129611-33-2 | 2A-0119823 |
| 2-BROMO-5-FLUORO-3-IODOPYRIDINE | 1214376-85-8 | 2A-0120090 |
| 2-BROMO-5-IODOPYRAZINE | 622392-04-5 | 2A-0120145 |
| 2-BROMO-6-IODOPYRIDIN-3-OL | 129611-32-1 | 2A-0120307 |
| 2-BROMO-6-IODOPYRIDIN-3-YL TERT-BUTYL CARBONATE | 1087659-26-4 | 2A-0120308 |
| 2-CHLORO-3-FLUORO-5-IODOPYRIDINE | 153034-99-2 | 2A-0120806 |
| 2-CHLORO-6-IODOPHENOL | 28177-52-8 | 2A-0121574 |
| 2-CYANO-5-IODOPYRIDINE | 41960-47-8 | 2A-0122043 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA