
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1032231-24-5 |
| Catalog No. | 2A-0120141 |
| Chinese Name | 2-溴-5-碘苯甲醛 |
| Synonyms | 2-bromo-5-iodobenzaldehyde |
| Molecular Formula | C7H4BrIO |
| Molecular Weight | 310.92 |
| Purity | 96+ |
| Storage Condition | 2-8°C, inert gas atmosphere |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 121279486 |
| SMILES | O=Cc1cc(I)ccc1Br |
| InChI | InChI=1S/C7H4BrIO/c8-7-2-1-6(9)3-5(7)4-10/h1-4H |
| InChI Key | AOWLJNHNEZGEOG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-BROMO-5-(TRIFLUOROMETHYL)PYRIDIN-3-OL | 1211537-52-8 | 2A-0201395 |
| 2-BROMO-5-CHLOROISONICOTINALDEHYDE | 921630-14-0 | 2A-1120061 |
| 2-BROMO-5-ETHOXY-4-HYDROXYBENZALDEHYDE | 340216-58-2 | 2A-0120082 |
| 2-BROMO-5-FLUOROISONICOTINALDEHYDE | 1005291-43-9 | 2A-1120115 |
| 2-BROMO-5-HYDROXY-4-METHYLBENZALDEHYDE | 57295-31-5 | 2A-0120131 |
| 2-BROMO-5-METHOXYBENZENE BORONIC ACID | 89694-44-0 | 2A-0120157 |
| 2-BROMO-5-METHYLBENZALDEHYDE | 90221-55-9 | 2A-0120172 |
| 2-BROMO-5-NITROBENZENECARBALDEHYDE | 84459-32-5 | 2A-0120196 |
| 2-BROMO-6-(TRIFLUOROMETHOXY)BENZALDEHYDE | 1114809-17-4 | 2A-0120242 |
| 2-BROMO-6-(TRIFLUOROMETHYL)ANILINE | 58458-13-2 | 2A-0120243 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA