
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 487-41-2 |
| Catalog No. | 2A-9011988 |
| Chinese Name | 连翘苷 |
| Synonyms | Pillyrin; Chionanthin; PHILLYRIN; Phillyroside; phyllyrin |
| Molecular Formula | C27H34O11 |
| Molecular Weight | 534.55 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 730.4±60.0 °C at 760 mmHg |
| Storage Condition | Room Temperature |
| Application | Phillyrin is isolated from Forsythia suspensa and has antibacterial and anti-inflammatory properties. Phillyrin has the potential to induce rat CYP1A2 and CYP2D1 without affecting CYP2C11 and CYP3A1/2 |
| HTC | 29389090 |
| SMILES | O[C@@H]([C@H](O)[C@@H](CO)O1)[C@@H](O)[C@@H]1OC(C=C2)=C(OC)C=C2[C@H]3OC[C@]4([H])[C@@H](OC[C@@]43[H])C5=CC(OC)=C(OC)C=C5 |
| InChI | 1S/C27H34O11/c1-32-17-6-4-13(8-19(17)33-2)25-15-11-36-26(16(15)12-35-25)14-5-7-18(20(9-14)34-3)37-27-24(31)23(30)22(29)21(10-28)38-27/h4-9,15-16,21-31H,10-12H2,1-3H3/t15-,16-,21+,22+,23-,24+,25-,26+,27+/m0/s1 |
| InChI Key | KFFCKOBAHMGTMW-LGQRSHAYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/11988_1_487_41_2.pdf |
| Transport Info | Product Name: Forsythin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Phenylmercury (II) borate | 102-98-7 | 2A-9011982 |
| Phenylmercuric borate | 104-32-5 | 2A-9011983 |
| Phenylmercuric chloride | 100-56-1 | 2A-9011984 |
| Phenylmercury nitrate | 55-68-5 | 2A-9011985 |
| Phenyltoloxamine citrate | 1176-08-5 | 2A-9011986 |
| Phlorizin dihydrate | 7061-54-3 | 2A-9011991 |
| Pholcodine | 509-67-1 | 2A-9011992 |
| Phomopsin A | 64925-80-0 | 2A-9011993 |
| Phorate | 298-02-2 | 2A-9011994 |
| Phosalone | 2310-17-0 | 2A-9011995 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA