
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90407-21-9 |
| Catalog No. | 2A-0119773 |
| Chinese Name | 2-溴-3-硝基苯甲醛 |
| Synonyms | Benzaldehyde,2-bromo-3-nitro; 2-Bromo-3-nitrobenzaldehyde; CL8255 |
| Molecular Formula | C9H8BrNO5 |
| Molecular Weight | 290.072 |
| Purity | 96+ |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 276.9±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas atmosphere |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00034518 |
| SMILES | O=Cc1cccc([N+](=O)[O-])c1Br |
| InChI Key | ZAYPDOMLBUBLDN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-BROMO-3-(TRIFLUOROMETHYL)BENZONITRILE | 914637-07-3 | 2A-0119680 |
| 2-BROMO-3-CHLORO-6-FLUOROBENZALDEHYDE | 1056264-66-4 | 2A-0119690 |
| 2-BROMO-3-CHLOROISONICOTINALDEHYDE | 1224604-18-5 | 2A-0119696 |
| 2-BROMO-3-FLUOROISONICOTINALDEHYDE HYDRATE | 1227572-94-2 | 2A-0119716 |
| 2-BROMO-3-HYDROXYBENZALDEHYDE | 196081-71-7 | 2A-0119726 |
| 2-BROMO-4,5-DIFLUOROBENZALDEHYDE | 476620-54-9 | 2A-0119804 |
| 2-BROMO-4-((TRIFLUOROMETHYL)SULFONYL)ANILINE | 16368-43-7 | 2A-0119829 |
| 2-BROMO-4-(BROMOMETHYL)BENZONITRILE | 89892-38-6 | 2A-0119840 |
| 2-BROMO-4-(TERT-BUTYL)BENZALDEHYDE | 246139-77-5 | 2A-0119847 |
| 2-BROMO-4-(TRIFLUOROMETHOXY)BENZALDEHYDE | 1114808-87-5 | 2A-0119852 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA