
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22061-78-5 |
| Catalog No. | 2A-0119762 |
| Chinese Name | 2-溴-3-甲基苯酚 |
| Synonyms | 2-bromo-3-methylphenol; 2-bromo-3-methyl-phenol; NCIOpen2_001879; NSC100895 |
| Molecular Formula | C7H7BrO |
| Molecular Weight | 187.04 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 215.2±20.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| SMILES | Cc1cccc(O)c1Br |
| InChI | InChI=1S/C7H7BrO/c1-5-3-2-4-6(9)7(5)8/h2-4,9H,1H3 |
| InChI Key | HUGNLEZLTOVJLD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-3-METHOXYNAPHTHALENE | 68251-77-4 | 2A-0119747 |
| 2-BROMO-3-METHYL-1-PHENYLBUTAN-1-ONE | 50735-03-0 | 2A-0119752 |
| 2-BROMO-3-METHYL-N-PHENYLBUTANAMIDE | 111216-73-0 | 2A-0119757 |
| 2-BROMO-3-METHYLBENZONITRILE | 263159-64-4 | 2A-0119760 |
| 2-BROMO-3-METHYLPENTANOIC ACID | 42880-22-8 | 2A-0119761 |
| 2-BROMO-3-METHYLPYRIDIN-4-AMINE | 79055-61-1 | 2A-0119764 |
| 2-BROMO-3-NITROANILINE | 35757-20-1 | 2A-0119771 |
| 2-BROMO-3-NITROBENZOTRIFLUORIDE | 24034-22-8 | 2A-0119775 |
| 2-BROMO-3-OXOPROPANENITRILE | 97925-42-3 | 2A-0119782 |
| 2-BROMO-3-PHENYLPROPANOIC ACID | 16503-53-0 | 2A-0119784 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA