
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42794-41-2 |
| Catalog No. | 2A-0119633 |
| Chinese Name | 2-溴-2-(2-硝基苯基)乙酸甲酯 |
| Synonyms | methyl 2-bromo-2'-nitrophenylacetate |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.068 |
| Purity | 96+ |
| Density | 1.631g/cm3 |
| Boiling Point | 356.806ºC at 760 mmHg |
| Storage Condition | 2-8°C, sealed storage, away from moisture and ligh |
| EINECS | 0 |
| HTC | 2916399090 |
| UN(IATA) | 0 |
| SMILES | COC(=O)C(Br)c1ccccc1[N+](=O)[O-] |
| InChI Key | ALNXYSMZZZSIHH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-2,3,3,3-TETRAFLUOROPROPANOIC ACID | 13859-31-9 | 2A-0119625 |
| 2-BROMO-2,3-DIHYDRO-1H-INDENE | 17623-96-0 | 2A-0119627 |
| 2-BROMO-2,3-DIHYDRO-4-FLUORO-1H-INDEN-1-ONE | 156484-68-3 | 2A-0119628 |
| 2-BROMO-2,3-DIHYDRO-5-FLUORO-1H-INDEN-1-ONE | 111538-45-5 | 2A-0119629 |
| 2-BROMO-2,3-DIHYDRO-6-FLUORO-1H-INDEN-1-ONE | 156484-83-2 | 2A-0119630 |
| 2-BROMO-2-(3,4-DICHLOROPHENYL)ACETIC ACID | 72191-59-4 | 2A-0119634 |
| 2-BROMO-2-(4-CHLOROPHENYL)ACETIC ACID | 3381-73-5 | 2A-0119635 |
| 2-BROMO-2-METHYLPROPANAL | 13206-46-7 | 2A-0119637 |
| 2-BROMO-3'-TRIFLUOROMETHOXYACETOPHENONE | 237386-01-5 | 2A-1119640 |
| 2-BROMO-3,3,3-TRIFLUORO-1-(4-METHYLPIPERAZIN-1-YL)PROPAN-1-ONE | 1031927-96-4 | 2A-0119641 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA