
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4225-92-7 |
| Catalog No. | 2A-0119620 |
| Chinese Name | 2-溴-1-(2,4,6-三甲基-苯基)-乙酮 |
| Synonyms | 2-bromo-1-mesitylethanone; 2,4,6-trimethylphenacyl bromide |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 |
| Purity | 96+ |
| Density | 1.317g/cm3 |
| Boiling Point | 297.8ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| SMILES | Cc1cc(C)c(C(=O)CBr)c(C)c1 |
| InChI | InChI=1S/C11H13BrO/c1-7-4-8(2)11(9(3)5-7)10(13)6-12/h4-5H,6H2,1-3H3 |
| InChI Key | HRAZXKYOYNRVMU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-1-METHOXYNAPHTHALENE | 62012-54-8 | 2A-0119596 |
| 2-BROMO-1-METHYL-4-(METHYLSULFONYL)BENZENE | 702672-96-6 | 2A-0119603 |
| 2-BROMO-1-PHENYLBUTAN-1-ONE | 877-35-0 | 2A-0119608 |
| 2-BROMO-1-PHENYLPENTAN-1-ONE | 49851-31-2 | 2A-1119611 |
| 2-BROMO-1H-INDENE-1,3(2H)-DIONE | 7319-63-3 | 2A-0119617 |
| 2-BROMO-2,2-DIFLUORO-1-PHENYLETHANONE | 1610-04-4 | 2A-0119624 |
| 2-BROMO-2,3,3,3-TETRAFLUOROPROPANOIC ACID | 13859-31-9 | 2A-0119625 |
| 2-BROMO-2,3-DIHYDRO-1H-INDENE | 17623-96-0 | 2A-0119627 |
| 2-BROMO-2,3-DIHYDRO-4-FLUORO-1H-INDEN-1-ONE | 156484-68-3 | 2A-0119628 |
| 2-BROMO-2,3-DIHYDRO-5-FLUORO-1H-INDEN-1-ONE | 111538-45-5 | 2A-0119629 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA