
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 698394-60-4 |
| Catalog No. | 2A-0119514 |
| Chinese Name | 2-溴-1-(4-乙基苯基)-2-甲基-1-丙酮 |
| Synonyms | 2-bromo-1-(4-ethylphenyl)-2-methylpropane-1-one |
| Molecular Formula | C12H14O1 |
| Molecular Weight | 174.24 |
| Purity | 96+ |
| Density | 1.275 g/cm3 |
| Boiling Point | 308.3ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD20920933 |
| SMILES | CCc1ccc(C(=O)C(C)(C)Br)cc1 |
| InChI Key | FRLPHWVDHFBDQG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-BROMO-1-(3-METHYL-1H-PYRAZOL-1-YL)PROPAN-1-ONE | 69413-07-6 | 2A-0119494 |
| 2-BROMO-1-(3-METHYLISOXAZOL-5-YL)ETHANONE | 104777-32-4 | 2A-0119495 |
| 2-BROMO-1-(4-(TERT-BUTYL)-2,6-DIMETHYL-3,5-DINITROPHENYL)ETHANONE | 175136-56-8 | 2A-0119501 |
| 2-BROMO-1-(4-BROMO-3-FLUOROPHENYL)ETHANONE | 1003879-02-4 | 2A-0119506 |
| 2-BROMO-1-(4-CHLOROPHENYL)-2-(P-TOLYL)ETHANONE | 119267-79-7 | 2A-0119511 |
| 2-BROMO-1-(4-FLUOROPHENYL)PROPAN-1-ONE | 345-94-8 | 2A-1119518 |
| 2-BROMO-1-(4-METHOXYPHENYL)PENTAN-1-ONE | 36412-64-3 | 2A-0119523 |
| 2-BROMO-1-(5,5,8,8-TETRAMETHYL-5,6,7,8-TETRAHYDRONAPHTHALEN-2-YL)ETHANONE | 132392-28-0 | 2A-0119526 |
| 2-BROMO-1-(5-CHLORO-2-METHOXYPHENYL)ETHANONE | 111841-05-5 | 2A-0119530 |
| 2-BROMO-1-(5-CHLOROPYRIDIN-2-YL)ETHANONE HYDROBROMIDE | 145905-09-5 | 2A-0119532 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA