
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 864293-44-7 |
| Catalog No. | 2A-0118571 |
| Chinese Name | 2-氨基-5-溴-3-甲氧基苯甲酸 |
| Synonyms | 2-Amino-5-bromo-3-methoxybenzoic acid; 2-amino-5-bromo-3-methoxy-benzoic acid hbr salt |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.058 |
| Purity | 96+ |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 356.0±42.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 93580348 |
| SMILES | COc1cc(Br)cc(C(=O)O)c1N |
| InChI | InChI=1S/C8H8BrNO3/c1-13-6-3-4(9)2-5(7(6)10)8(11)12/h2-3H,10H2,1H3,(H,11,12) |
| InChI Key | YSBGYQUUOKRQAT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-AMINO-5,6,7,8-TETRAHYDRO-4-PHENYL-4H-1-BENZOPYRAN-3-CARBONITRILE | 164026-52-2 | 2A-0118501 |
| 2-AMINO-5-(1,3-DIOXOLAN-2-YL)PENTANOIC ACID | 170242-34-9 | 2A-0118516 |
| 2-AMINO-5-(METHOXYCARBONYL)BENZOIC ACID | 63746-25-8 | 2A-0118534 |
| 2-AMINO-5-(PIPERIDIN-1-YL)BENZAMIDE | 314768-97-3 | 2A-0118538 |
| 2-AMINO-5-BENZYLOXY-4-METHOXYBENZOIC ACID | 909912-09-0 | 2A-0118550 |
| 2-AMINO-5-BROMO-3-METHYLBENZOIC ACID | 206548-13-2 | 2A-0118572 |
| 2-AMINO-5-BROMO-3-NITROBENZOIC ACID | 58580-07-7 | 2A-0118576 |
| 2-AMINO-5-BROMO-4-METHOXYBENZOIC ACID | 169045-04-9 | 2A-0118590 |
| 2-AMINO-5-BROMO-N,N-DIMETHYLBENZAMIDE | 139253-79-5 | 2A-0118601 |
| 2-AMINO-5-BROMOBENZAMIDE | 16313-66-9 | 2A-0118603 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA