
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 491837-88-8 |
| Catalog No. | 2A-1118499 |
| Chinese Name | 2-amino-1-(3-bromophenyl)ethanone |
| Synonyms | 2-Amino-1-(3-bromophenyl)-ethanone |
| Molecular Formula | C8H8BrNO |
| Molecular Weight | 214.059 |
| Purity | 96+ |
| Density | 1.52g/cm3 |
| Boiling Point | 317.9ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2922399090 |
| UN(IATA) | 0 |
| PubChem ID | 4978030 |
| SMILES | NCC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C8H8BrNO/c9-7-3-1-2-6(4-7)8(11)5-10/h1-4H,5,10H2 |
| InChI Key | LXFGLRAUAQVJCL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-AMINO-4-CHLORO-5-FLUOROBENZOIC ACID | 108288-16-0 | 2A-0118388 |
| 2-AMINO-4-CHLORONICOTINIC ACID | 605661-83-4 | 2A-0118411 |
| 2-AMINO-4-ETHYLPHENOL | 94109-11-2 | 2A-0118423 |
| 2-AMINO-4-ISOPROPYLPHENOL | 3280-68-0 | 2A-0118442 |
| 2-AMINO-4-METHYLPYRIDIN-3-OL | 20348-18-9 | 2A-0118465 |
| 2-AMINO-5,6,7,8-TETRAHYDRO-4-PHENYL-4H-1-BENZOPYRAN-3-CARBONITRILE | 164026-52-2 | 2A-0118501 |
| 2-AMINO-5-(1,3-DIOXOLAN-2-YL)PENTANOIC ACID | 170242-34-9 | 2A-0118516 |
| 2-AMINO-5-(METHOXYCARBONYL)BENZOIC ACID | 63746-25-8 | 2A-0118534 |
| 2-AMINO-5-(PIPERIDIN-1-YL)BENZAMIDE | 314768-97-3 | 2A-0118538 |
| 2-AMINO-5-BENZYLOXY-4-METHOXYBENZOIC ACID | 909912-09-0 | 2A-0118550 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA