
CAS Number41870-82-0
Synonyms(R)-(+)-4-Bromomandelonitrile; (R)-2-(4-bromophenyl)-2-hydroxyacetonitrile; (±)-a-(Aminomethyl)-p-chlorobenzyl alcohol; 2-(4-chlorophenyl)-2-hydroxyethylamine; 2-Amino-1-(4-chlorophenyl)ethanol; 2-hydroxy-2-(4-chlorophenyl)-ethanamine; rac-2-amino-1-(4-chlorophenyl)ethanol; 1-(p-chlorophenyl)-2-aminoethanol; 2-Amino-1-(4-chlorophenyl)ethanol HCl; 2-Amino-1-(4-chloro-phenyl)-ethanol; 2-(4-bromophenyl)-2-hydroxyacetonitrile; 2-hydroxy-2-(4-bromophenyl)acetonitrile
Molecular FormulaC8H10O1N1Cl1
Molecular Weight171.63
Purity96+%
Density1.3±0.1 g/cm3
Boiling Point319.8±27.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41870-82-0 |
| Catalog No. | 2A-0117780 |
| Chinese Name | 2-氨基-1-(4-氯苯基)乙醇 |
| Synonyms | (R)-(+)-4-Bromomandelonitrile; (R)-2-(4-bromophenyl)-2-hydroxyacetonitrile; (±)-a-(Aminomethyl)-p-chlorobenzyl alcohol; 2-(4-chlorophenyl)-2-hydroxyethylamine; 2-Amino-1-(4-chlorophenyl)ethanol; 2-hydroxy-2-(4-chlorophenyl)-ethanamine; rac-2-amino-1-(4-chlorophenyl)ethanol; 1-(p-chlorophenyl)-2-aminoethanol; 2-Amino-1-(4-chlorophenyl)ethanol HCl; 2-Amino-1-(4-chloro-phenyl)-ethanol; 2-(4-bromophenyl)-2-hydroxyacetonitrile; 2-hydroxy-2-(4-bromophenyl)acetonitrile |
| Molecular Formula | C8H10O1N1Cl1 |
| Molecular Weight | 171.63 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 319.8±27.0 °C at 760 mmHg |
| EINECS | 0 |
| HTC | 2922199090 |
| UN(IATA) | 0 |
| PubChem ID | 3191750 |
| MDL Number | MFCD09759235 |
| SMILES | NCC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H10ClNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4,8,11H,5,10H2 |
| InChI Key | QPHAZZJNYDEVHL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-AMINO-1-(2-CHLOROPHENYL)ETHANOL | 23496-56-2 | 2A-0117686 |
| 2-AMINO-1-(2-CHLOROPHENYL)ETHANOL HYDROCHLORIDE | 40570-86-3 | 2A-0117687 |
| 2-AMINO-1-(2-FLUOROPHENYL)ETHANOL HYDROCHLORIDE | 849928-38-7 | 2A-0117702 |
| 2-AMINO-1-(3, 4-DIMETHOXYPHENYL)ETHANOL | 6924-15-8 | 2A-0117713 |
| 2-AMINO-1-(3-PHENOXYPHENYL)ETHANOL HYDROCHLORIDE | 133562-41-1 | 2A-0117755 |
| 2-AMINO-1-(4-NITROPHENYL)ETHANOL | 16428-47-0 | 2A-2117816 |
| 2-AMINO-1-(PYRIDIN-3-YL)ETHANOL | 92990-44-8 | 2A-0117833 |
| 2-AMINO-1-(TETRAHYDRO-2H-PYRAN-4-YL)ETHANOL | 911060-79-2 | 2A-0117835 |
| 2-AMINO-1-CYCLOPROPYLETHANOL | 54120-02-4 | 2A-0117847 |
| 2-AMINO-1-PHENYLETHANOL HYDROCHLORIDE | 15995-85-4 | 2A-0117853 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA