
CAS Number79517-01-4
SynonymsSandostatin (TN); Octreotide acetate (USAN); Octreotide (acetate); Octreotide; Octreotide Acetate; SMS 201-995; Sandostatin LAR; Sandostatin; zacycloicosane-4-carboxamide acetate
Molecular FormulaC51H70N10O12S2
Molecular Weight2038.48
Purity98%
Density1.4±0.1 g/cm3
Boiling Point1447.2±65.0 °C at 760 mmHg
Melting Point153-156ºC
AppearanceColorless to off-white freeze-dried solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 79517-01-4 |
| Catalog No. | 2A-9011741 |
| Chinese Name | 奥曲肽 |
| Synonyms | Sandostatin (TN); Octreotide acetate (USAN); Octreotide (acetate); Octreotide; Octreotide Acetate; SMS 201-995; Sandostatin LAR; Sandostatin; zacycloicosane-4-carboxamide acetate |
| Molecular Formula | C51H70N10O12S2 |
| Molecular Weight | 2038.48 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1447.2±65.0 °C at 760 mmHg |
| Melting Point | 153-156ºC |
| Appearance | Colorless to off-white freeze-dried solid |
| Storage Condition | The warehouse is low-temperature, ventilated, dry, |
| Application | Octreotide acetate is a long-acting synthetic analog of natural somatostatin, which is a more effective inhibitor of growth hormone, glucagon and insulin than somatostatin. |
| SMILES | CC(=O)O.CC(O)C(CO)NC(=O)C1CSSCC(NC(=O)C(N)Cc2ccccc2)C(=O)NC(Cc2ccccc2)C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)N1 |
| InChI | InChI=1S/C49H66N10O10S2.2C2H4O2/c1-28(61)39(25-60)56-48(68)41-27-71-70-26-40(57-43(63)34(51)21-30-13-5-3-6-14-30)47(67)54-37(22-31-15-7-4-8-16-31)45(65)55-38(23-32-24-52-35-18-10-9-17-33(32)35)46(66)53-36(19-11-12-20-50)44(64)59-42(29(2)62)49(69)58-41;2*1-2(3)4/h3-10,13-18,24,28-29,34,36-42,52,60-62H,11-12,19-23,25-27,50-51H2,1-2H3,(H,53,66)(H,54,67)(H,55,65)(H,56,68)(H,57,63)(H,58,69)(H,59,64);2*1H3,(H,3,4)/t28-,29?,34?,36?,37?,38?,39-,40?,41?,42?;;/m1../s1 |
| InChI Key | XQEJFZYLWPSJOV-XJQYZYIXSA-N |
| NACRES Code | NA.24 |
| MSDS | msds/11741_1_79517_01_4.pdf |
| Transport Info | Product name: Octreotide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Octafonium chloride | 15687-40-8 | 2A-9011736 |
| Octamethylpyrophosphoramide | 152-16-9 | 2A-9011737 |
| Octenidine | 71251-02-0 | 2A-9011738 |
| Octimibate | 89838-96-0 | 2A-9011739 |
| Octoclothepin | 13448-22-1 | 2A-9011740 |
| Octreotide acetate | 83150-76-9 | 2A-9011742 |
| Octylonium bromide | 26095-59-0 | 2A-9011743 |
| Odulimomab | 159445-64-4 | 2A-9011746 |
| Ofornine | 87784-12-1 | 2A-9011748 |
| Olamufloxacin | 167887-97-0 | 2A-9011749 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA