
CAS Number16627-71-7
SynonymsMFCD00155904; 1H,1H,5H-Octafluoropentyl 1,1,2,2-Tetrafluoroethyl Ether; 1,1,2,2,3,3,4,4-Octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane
Molecular FormulaC7H4O1F12
Molecular Weight332.09
Purity97%
Density1.532 g/cm3
Boiling Point133ºC
AppearanceLiquid;Colorless to Almost colorless clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16627-71-7 |
| Catalog No. | 2A-9001174 |
| Chinese Name | 1H,1H,5H-八氟戊基-1,1,2,2-四氟乙基醚 |
| Synonyms | MFCD00155904; 1H,1H,5H-Octafluoropentyl 1,1,2,2-Tetrafluoroethyl Ether; 1,1,2,2,3,3,4,4-Octafluoro-5-(1,1,2,2-tetrafluoroethoxy)pentane |
| Molecular Formula | C7H4O1F12 |
| Molecular Weight | 332.09 |
| Purity | 97 |
| Density | 1.532 g/cm3 |
| Boiling Point | 133ºC |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Room Temperature |
| Packaging | III |
| HTC | 2909199090 |
| MDL Number | MFCD00155904 |
| SMILES | FC(F)C(F)(F)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI Key | ZNBGTBKGFZMWKR-UHFFFAOYSA-N |
| Hazard Symbols | 3.0 |
| MSDS | msds/1174_1_16627_71_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 3271 1H,1H,5H-Octafluoropentyl 1,1,2,2-tetrafluoroethyl ether Modification number: 5.3 Module 14. Shipping information Proper shipping name: Ethers, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1H,1H,3H-Hexafluorobutyl methacrylate | 36405-47-7 | 2A-9001169 |
| 1H,1H,5H-Octafluoropentyl 2-fluoroacrylate | 87910-92-7 | 2A-9001170 |
| 1H,1H,5H-Octafluoropentyl acrylate | 376-84-1 | 2A-9001171 |
| 1H,1H,5H-Octafluoropentyl iodide | 678-74-0 | 2A-9001172 |
| 1H,1H,5H-Octafluoropentyl methacrylate | 355-93-1 | 2A-9001173 |
| 1H,1H,9H-Hexadecafluorononyl methacrylate | 1841-46-9 | 2A-9001175 |
| 1H,2H-Octafluorocyclopentane | 828-35-3 | 2A-9001177 |
| 1-Heptanesulfonic acid sodium salt | 22767-50-6 | 2A-9001184 |
| 1-Heptyl-2-thiourea | 3098-03-1 | 2A-9001185 |
| 1-Heptyl-3-phenyl-2-thiourea | 79425-04-0 | 2A-9001186 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA