
CAS Number13250-82-3
Synonyms3-(1,3-Dioxolan-2-yl)thiophene; 2-thiophen-3-yl-1,3-dioxolane; 2-(Thiophen-3-yl)-1,3-dioxolane
Molecular FormulaC7H8O2S
Molecular Weight156.21
Purity96+%
Density1.254 g/cm3
Boiling Point245.3ºCat 760 mmHg
AppearanceLiquid;Colorless to Light yellow to Light orange clear liquid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13250-82-3 |
| Catalog No. | 2A-0117276 |
| Chinese Name | 2-(3-噻吩基)-1,3-二氧戊环 |
| Synonyms | 3-(1,3-Dioxolan-2-yl)thiophene; 2-thiophen-3-yl-1,3-dioxolane; 2-(Thiophen-3-yl)-1,3-dioxolane |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 |
| Purity | 96+ |
| Density | 1.254 g/cm3 |
| Boiling Point | 245.3ºCat 760 mmHg |
| Appearance | Liquid;Colorless to Light yellow to Light orange clear liquid |
| Storage Condition | 0-10°C; avoid light, heat |
| EINECS | 0 |
| HTC | 2934999090 |
| UN(IATA) | 0 |
| PubChem ID | 134817 |
| SMILES | c1cc(C2OCCO2)cs1 |
| InChI | InChI=1S/C7H8O2S/c1-4-10-5-6(1)7-8-2-3-9-7/h1,4-5,7H,2-3H2 |
| InChI Key | VOJKCZSSUHBMKS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(TERT-BUTOXY)-4-METHYLPYRIDINE | 57883-15-5 | 2A-0117189 |
| 2-(TERT-BUTYL)-1H-IMIDAZOLE | 36947-69-0 | 2A-0117203 |
| 2-(TETRAHYDROFURAN-2-YL)ACETONITRILE | 33414-62-9 | 2A-0117257 |
| 2-(THIOPHEN-2-YL)-1H-BENZO[D]IMIDAZOLE-5-CARBOXYLIC ACID | 174422-11-8 | 2A-0117264 |
| 2-(THIOPHEN-2-YL)-1H-BENZO[D]IMIDAZOLE-7-CARBOXYLIC ACID | 124340-77-8 | 2A-0117265 |
| 2-(TRIFLUOROACETYL)PYRROLE | 2557-70-2 | 2A-0117288 |
| 2-(TRIFLUOROMETHYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID | 915030-08-9 | 2A-0117302 |
| 2-(TRIFLUOROMETHYL)-1H-IMIDAZOLE | 66675-22-7 | 2A-0117305 |
| 2-(TRIFLUOROMETHYL)-1H-IMIDAZOLE-4,5-DICARBOXYLIC ACID | 78016-96-3 | 2A-0117306 |
| 2-(TRIFLUOROMETHYL)-3H-IMIDAZO[4,5-B]PYRIDINE | 13797-63-2 | 2A-0117310 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA