
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 952182-68-2 |
| Catalog No. | 2A-0116954 |
| Chinese Name | 2-(哌啶-1-基)噻唑-4-羧酸 |
| Synonyms | 2-(1-Piperidinyl)-1,3-thiazole-4-carboxylic acid; 2-piperidin-1-yl-1,3-thiazole-4-carboxylic acid |
| Molecular Formula | C9H12O2N2S1 |
| Molecular Weight | 212.27 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 404.8±37.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| EINECS | 0 |
| HTC | 2934100090 |
| UN(IATA) | 0 |
| PubChem ID | 56082522 |
| MDL Number | MFCD09027189 |
| SMILES | O=C(O)c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C9H12N2O2S/c12-8(13)7-6-14-9(10-7)11-4-2-1-3-5-11/h6H,1-5H2,(H,12,13) |
| InChI Key | CTYVDXOBZLKERL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(PIPERAZIN-1-YL)BENZO[D]OXAZOLE-5-SULFONAMIDE | 1035840-39-1 | 2A-0116929 |
| 2-(PIPERAZIN-1-YL)PYRAZINE | 34803-68-4 | 2A-0116936 |
| 2-(PIPERIDIN-1-YL)BENZO[D]THIAZOLE | 2851-08-3 | 2A-0116946 |
| 2-(PIPERIDIN-1-YL)PYRIMIDINE | 51957-36-9 | 2A-0116952 |
| 2-(PIPERIDIN-1-YL)THIAZOLE | 4175-70-6 | 2A-0116953 |
| 2-(PIPERIDIN-1-YL)THIAZOLE-5-CARBALDEHYDE | 129865-52-7 | 2A-0116955 |
| 2-(PIPERIDIN-2-YL)-1H-BENZO[D]IMIDAZOLE | 51785-23-0 | 2A-0116956 |
| 2-(PIPERIDIN-2-YL)PYRIDINE | 15578-73-1 | 2A-0116978 |
| 2-(PIPERIDIN-2-YL)PYRIDINE DIHYDROCHLORIDE | 143924-44-1 | 2A-0116979 |
| 2-(PIPERIDIN-3-YLOXY)PYRIDINE | 862718-70-5 | 2A-0117015 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA