
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41906-86-9 |
| Catalog No. | 2A-9011681 |
| Chinese Name | 头孢硝噻吩 |
| Synonyms | nitrocefin |
| Molecular Formula | C21H16N4O8S2 |
| Molecular Weight | 516.50 |
| Purity | ≥95 (UV) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 872.0±65.0 °C at 760 mmHg |
| Melting Point | >99℃ |
| Appearance | solid |
| Storage Condition | Sealed, stored at 2ºC -8ºC |
| Application | Nitrocefafen is a chromogenic β-lactamase substrate that undergoes a unique color change from yellow to red when the amide bond in the β-lactam ring is hydrolyzed by β-lactamase. Nitrocefafen is used |
| MDL Number | MFCD12165893 |
| SMILES | [s]1c(ccc1)CC(=O)N[C@H]2[C@H]3SCC(=C(N3C2=O)C(=O)O)\C=C\c4c(cc(cc4)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C21H16N4O8S2/c26-16(9-14-2-1-7-34-14)22-17-19(27)23-18(21(28)29)12(10-35-20(17)23)4-3-11-5-6-13(24(30)31)8-15(11)25(32)33/h1-8,17,20H,9-10H2,(H,22,26)(H,28,29)/b4-3+/t17-,20-/m1/s1 |
| InChI Key | LHNIIDJCEODSHA-OQRUQETBSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/11681_1_41906_86_9.pdf |
| Transport Info | Product name: Cephalosporin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Nimustine hydrochloride | 55661-38-6 | 2A-9011674 |
| Nipradilol | 81486-22-8 | 2A-9011675 |
| Nisoldipine | 63675-72-9 | 2A-9011676 |
| Nitazoxanide | 55981-09-4 | 2A-9011677 |
| Nitrendipine | 39562-70-4 | 2A-9011680 |
| Nitrofluorfen | 42874-01-1 | 2A-9011682 |
| Nitromersolum | 2A-302767 | 2A-9011684 |
| Nixylic acid | 4394-05-2 | 2A-9011685 |
| N-methyl glucamine antimoniate | 133-51-7 | 2A-9011686 |
| Nofecainide | 50516-43-3 | 2A-9011689 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA