
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38544-16-0 |
| Catalog No. | 2A-0116189 |
| Chinese Name | 2-(苄氧基)-5-氯苯甲醛 |
| Synonyms | 2-Benzyloxy-5-chlor-benzaldehyd |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 |
| Purity | 96+ |
| Density | 1.247g/cm3 |
| Boiling Point | 384.9ºC at 760 mmHg |
| Storage Condition | 2-8°C, inert gas |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 3580167 |
| SMILES | O=Cc1cc(Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C14H11ClO2/c15-13-6-7-14(12(8-13)9-16)17-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChI Key | UKVVPQTUCJPTNI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(BENZYLOXY)-3-(DIMETHYLAMINO)ACRYLALDEHYDE | 143462-35-5 | 2A-0116171 |
| 2-(BENZYLOXY)-3-FLUOROBENZALDEHYDE | 148872-79-1 | 2A-0116172 |
| 2-(BENZYLOXY)-4-BROMO-1-(TRIFLUOROMETHYL)BENZENE | 1314987-55-7 | 2A-0116174 |
| 2-(BENZYLOXY)-4-BROMOBENZALDEHYDE | 142602-43-5 | 2A-0116178 |
| 2-(BENZYLOXY)-5-BROMOBENZALDEHYDE | 121124-94-5 | 2A-0116187 |
| 2-(BENZYLOXY)-5-HYDROXYBENZALDEHYDE | 161192-21-8 | 2A-0116193 |
| 2-(BENZYLOXY)-5-METHYLBENZALDEHYDE | 53389-98-3 | 2A-0116195 |
| 2-(BROMOMETHYL)-1,3-DICHLORO-4-NITROBENZENE | 83141-02-0 | 2A-0116224 |
| 2-(BROMOMETHYL)-1-CHLORO-3-(TRIFLUOROMETHYL)BENZENE | 886500-26-1 | 2A-1116228 |
| 2-(BROMOMETHYL)-1-METHYL-4-NITROBENZENE | 98799-27-0 | 2A-0116233 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA