
CAS Number459-26-7
Synonyms1-Ethoxy-4-fluorobenzene; EINECS 207-287-3; Ethyl 4-fluorophenyl ether; p-fluorophenetole; MFCD00017953; 4-FLUOROPHENETOLE
Molecular FormulaC8H9O1F1
Molecular Weight140.16
Purity98%
Density1.0±0.1 g/cm3
Boiling Point179.5±13.0 °C at 760 mmHg
Melting Point-8.5 °C
AppearanceLiquid;Colorless to Almost colorless clear liquid
EINECS207-287-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 459-26-7 |
| Catalog No. | 2A-9001156 |
| Chinese Name | 4-氟苯乙醚 |
| Synonyms | 1-Ethoxy-4-fluorobenzene; EINECS 207-287-3; Ethyl 4-fluorophenyl ether; p-fluorophenetole; MFCD00017953; 4-FLUOROPHENETOLE |
| Molecular Formula | C8H9O1F1 |
| Molecular Weight | 140.16 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 179.5±13.0 °C at 760 mmHg |
| Melting Point | -8.5 °C |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store in a sealed container in a ventilated and dr |
| EINECS | 207-287-3 |
| HTC | 2909309090 |
| MDL Number | MFCD00017953 |
| SMILES | CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C8H9FO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| InChI Key | PURLWQWDGIIYBG-UHFFFAOYSA-N |
| MSDS | msds/1156_1_459_26_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Dehydroandrenosterone | 7738-93-4 | 2A-9001151 |
| 1-Dihyroandrostanolone | 2A-101152 | 2A-9001152 |
| 1-Dimethylamino-2-nitroethylene | 1190-92-7 | 2A-9001153 |
| 1-Ethoxy-4-(trans-4-n-pentylcyclohexyl)benzene | 84540-32-9 | 2A-9001154 |
| 1-Ethoxy-4-(trans-4-n-propylcyclohexyl)benzene | 80944-44-1 | 2A-9001155 |
| 1-Ethyl-4-piperidone | 3612-18-8 | 2A-9001161 |
| 1-Fluoro-3-iodobenzene | 1121-86-4 | 2A-9001164 |
| 1H,1H,2H,2H-Heptadecafluorodecyl methacrylate | 1996-88-9 | 2A-9001167 |
| 1H,1H,3H-Hexafluorobutyl methacrylate | 36405-47-7 | 2A-9001169 |
| 1H,1H,5H-Octafluoropentyl 2-fluoroacrylate | 87910-92-7 | 2A-9001170 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA